Merge tag '2023.11.0' into merge-upstream

2023-11-06 06:42:28 +09:00
parent 9fb3966b53 0c2dd33593
commit 2bc887a6c5
301 changed files with 9351 additions and 3283 deletions
--- a/packages/frontend/src/components/MkAbuseReportResolver.vue
+++ b/packages/frontend/src/components/MkAbuseReportResolver.vue
@@ -8,18 +8,15 @@ SPDX-License-Identifier: AGPL-3.0-only
 	<MkInput v-model="value.name" :readonly="!props.editable">
 		<template #label>{{ i18n.ts.name }}</template>
 	</MkInput>
-	<div>
-		<div :class="$style.label">{{ i18n.ts._abuse._resolver.targetUserPattern }}</div>
-		<PrismEditor v-model="value.targetUserPattern" placeholder="^(LocalUser|RemoteUser@RemoteHost)$" class="_code code" :class="$style.highlight" :highlight="highlighter" :lineNumbers="false" :ignoreTabKey="true" :readonly="!props.editable"/>
-	</div>
-	<div>
-		<div :class="$style.label">{{ i18n.ts._abuse._resolver.reporterPattern }}</div>
-		<PrismEditor v-model="value.reporterPattern" placeholder="^(LocalUser|.*@RemoteHost)$" class="_code code" :class="$style.highlight" :highlight="highlighter" :lineNumbers="false" :ignoreTabKey="true" :readonly="!props.editable"/>
-	</div>
-	<div>
-		<div :class="$style.label">{{ i18n.ts._abuse._resolver.reportContentPattern }}</div>
-		<PrismEditor v-model="value.reportContentPattern" placeholder=".*" class="_code code" :class="$style.highlight" :highlight="highlighter" :lineNumbers="false" :ignoreTabKey="true" :readonly="!props.editable"/>
-	</div>
+	<MkInput v-model="value.targetUserPattern" placeholder="^(LocalUser|RemoteUser@RemoteHost)$" :readonly="!props.editable" :code="true">
+		<template #label>{{ i18n.ts._abuse._resolver.targetUserPattern }}</template>
+	</MkInput>
+	<MkInput v-model="value.reporterPattern" placeholder="^(LocalUser|.*@RemoteHost)$" :readonly="!props.editable" :code="true">
+		<template #label>{{ i18n.ts._abuse._resolver.reporterPattern }}</template>
+	</MkInput>
+	<MkInput v-model="value.reportContentPattern" placeholder=".*" :readonly="!props.editable" :code="true">
+		<template #label>{{ i18n.ts._abuse._resolver.reportContentPattern }}</template>
+	</MkInput>
 	<MkSelect v-model="value.expiresAt" :disabled="!props.editable">
 		<template #label>{{ i18n.ts._abuse._resolver.expiresAt }}<span v-if="expirationDate" style="float: right;"><MkDate :time="expirationDate" mode="absolute">{{ expirationDate }}</MkDate></span></template>
 		<option value="1hour">{{ i18n.ts._abuse._resolver['1hour'] }}</option>
@@ -41,16 +38,10 @@ SPDX-License-Identifier: AGPL-3.0-only
 </template>
 <script lang="ts" setup>
 import { computed, watch } from 'vue';
-import { PrismEditor } from 'vue-prism-editor';
-import { highlight, languages } from 'prismjs/components/prism-core';
 import MkInput from '@/components/MkInput.vue';
 import MkSelect from '@/components/MkSelect.vue';
 import MkSwitch from '@/components/MkSwitch.vue';
-import { i18n } from '@/i18n';
-import 'vue-prism-editor/dist/prismeditor.min.css';
-import 'prismjs/components/prism-clike';
-import 'prismjs/components/prism-regex';
-import 'prismjs/themes/prism-okaidia.css';
+import { i18n } from '@/i18n.js';

 const props = defineProps<{
 	modelValue?: {
@@ -112,10 +103,6 @@ const value = computed({
 	},
 });

-function highlighter(code) {
-	return highlight(code, languages.regex);
-}
-
 function renderExpirationDate(empty = false) {
 	if (value.value.expirationDate && !empty) {
 		expirationDate = new Date(value.value.expirationDate);
@@ -133,28 +120,10 @@ watch(() => props.editable, () => {
 });

 </script>
-<style lang="scss">
-.dslkjkwejflew .prism-editor__textarea {
-	padding-left: 10px !important;
-	padding-bottom: 10px !important;
-}
-
-.dslkjkwejflew .prism-editor__editor {
-	padding-left: 10px !important;
-	padding-bottom: 10px !important;
-}
-</style>
 <style lang="scss" module>
 .label {
 	font-size: 0.85em;
 	padding: 0 0 8px 0;
 	user-select: none;
 }
-.highlight {
-	padding: 0;
-	position: relative;
-	padding-top: 6px;
-	padding-bottom: 6px;
-	border-radius: 4px;
-}
 </style>
--- a/packages/frontend/src/components/MkCode.core.vue
+++ b/packages/frontend/src/components/MkCode.core.vue
@@ -5,21 +5,90 @@ SPDX-License-Identifier: AGPL-3.0-only

 <!-- eslint-disable vue/no-v-html -->
 <template>
-<code v-if="inline" :class="`language-${prismLang}`" style="overflow-wrap: anywhere;" v-html="html"></code>
-<pre v-else :class="`language-${prismLang}`"><code :class="`language-${prismLang}`" v-html="html"></code></pre>
+<div :class="['codeBlockRoot', { 'codeEditor': codeEditor }]" v-html="html"></div>
 </template>

 <script lang="ts" setup>
-import { computed } from 'vue';
-import Prism from 'prismjs';
-import 'prismjs/themes/prism-okaidia.css';
+import { ref, computed, watch } from 'vue';
+import { BUNDLED_LANGUAGES } from 'shiki';
+import type { Lang as ShikiLang } from 'shiki';
+import { getHighlighter } from '@/scripts/code-highlighter.js';

 const props = defineProps<{
 	code: string;
 	lang?: string;
-	inline?: boolean;
+	codeEditor?: boolean;
 }>();

-const prismLang = computed(() => Prism.languages[props.lang] ? props.lang : 'js');
-const html = computed(() => Prism.highlight(props.code, Prism.languages[prismLang.value], prismLang.value));
+const highlighter = await getHighlighter();
+
+const codeLang = ref<ShikiLang | 'aiscript'>('js');
+const html = computed(() => highlighter.codeToHtml(props.code, {
+	lang: codeLang.value,
+	theme: 'dark-plus',
+}));
+
+async function fetchLanguage(to: string): Promise<void> {
+	const language = to as ShikiLang;
+
+	// Check for the loaded languages, and load the language if it's not loaded yet.
+	if (!highlighter.getLoadedLanguages().includes(language)) {
+		// Check if the language is supported by Shiki
+		const bundles = BUNDLED_LANGUAGES.filter((bundle) => {
+			// Languages are specified by their id, they can also have aliases (i. e. "js" and "javascript")
+			return bundle.id === language || bundle.aliases?.includes(language);
+		});
+		if (bundles.length > 0) {
+			await highlighter.loadLanguage(language);
+			codeLang.value = language;
+		} else {
+			codeLang.value = 'js';
+		}
+	} else {
+		codeLang.value = language;
+	}
+}
+
+watch(() => props.lang, (to) => {
+	if (codeLang.value === to || !to) return;
+	return new Promise((resolve) => {
+		fetchLanguage(to).then(() => resolve);
+	});
+}, { immediate: true, });
 </script>
+
+<style scoped lang="scss">
+.codeBlockRoot :deep(.shiki) {
+	padding: 1em;
+	margin: .5em 0;
+	overflow: auto;
+	border-radius: .3em;
+
+	& pre,
+	& code {
+		font-family: Consolas, Monaco, Andale Mono, Ubuntu Mono, monospace;
+	}
+}
+
+.codeBlockRoot.codeEditor {
+	min-width: 100%;
+	height: 100%;
+
+	& :deep(.shiki) {
+		padding: 12px;
+		margin: 0;
+		border-radius: 6px;
+		min-height: 130px;
+		pointer-events: none;
+		min-width: calc(100% - 24px);
+		height: 100%;
+		display: inline-block;
+		line-height: 1.5em;
+		font-size: 1em;
+		overflow: visible;
+		text-rendering: inherit;
+    text-transform: inherit;
+    white-space: pre;
+	}
+}
+</style>
--- a/packages/frontend/src/components/MkCode.vue
+++ b/packages/frontend/src/components/MkCode.vue
@@ -4,11 +4,18 @@ SPDX-License-Identifier: AGPL-3.0-only
 -->

 <template>
-<XCode :code="code" :lang="lang" :inline="inline"/>
+	<Suspense>
+		<template #fallback>
+			<MkLoading v-if="!inline ?? true" />
+		</template>
+		<code v-if="inline" :class="$style.codeInlineRoot">{{ code }}</code>
+		<XCode v-else :code="code" :lang="lang"/>
+	</Suspense>
 </template>

 <script lang="ts" setup>
 import { defineAsyncComponent } from 'vue';
+import MkLoading from '@/components/global/MkLoading.vue';

 defineProps<{
 	code: string;
@@ -18,3 +25,15 @@ defineProps<{

 const XCode = defineAsyncComponent(() => import('@/components/MkCode.core.vue'));
 </script>
+
+<style module lang="scss">
+.codeInlineRoot {
+	display: inline-block;
+	font-family: Consolas, Monaco, Andale Mono, Ubuntu Mono, monospace;
+	overflow-wrap: anywhere;
+	color: #D4D4D4;
+	background: #1E1E1E;
+	padding: .1em;
+	border-radius: .3em;
+}
+</style>
--- a/packages/frontend/src/components/MkCodeEditor.vue
+++ b/packages/frontend/src/components/MkCodeEditor.vue
@@ -0,0 +1,168 @@
+<!--
+SPDX-FileCopyrightText: syuilo and other misskey contributors
+SPDX-License-Identifier: AGPL-3.0-only
+-->
+
+<template>
+<div :class="[$style.codeEditorRoot, { [$style.disabled]: disabled, [$style.focused]: focused }]">
+	<div :class="$style.codeEditorScroller">
+		<textarea
+			ref="inputEl"
+			v-model="vModel"
+			:class="[$style.textarea]"
+			:placeholder="placeholder"
+			:disabled="disabled"
+			:required="required"
+			:readonly="readonly"
+			autocomplete="off"
+			wrap="off"
+			spellcheck="false"
+			@focus="focused = true"
+			@blur="focused = false"
+			@keydown="onKeydown($event)"
+			@input="onInput"
+		></textarea>
+		<XCode :class="$style.codeEditorHighlighter" :codeEditor="true" :code="v" :lang="lang"/>
+	</div>
+</div>
+</template>
+
+<script lang="ts" setup>
+import { ref, watch, toRefs, shallowRef, nextTick } from 'vue';
+import XCode from '@/components/MkCode.core.vue';
+
+const props = withDefaults(defineProps<{
+	modelValue: string | null;
+	lang: string;
+	placeholder?: string;
+	required?: boolean;
+	readonly?: boolean;
+	disabled?: boolean;
+}>(), {
+	lang: 'js',
+});
+
+const emit = defineEmits<{
+	(ev: 'change', _ev: KeyboardEvent): void;
+	(ev: 'keydown', _ev: KeyboardEvent): void;
+	(ev: 'enter'): void;
+	(ev: 'update:modelValue', value: string): void;
+}>();
+
+const { modelValue } = toRefs(props);
+const vModel = ref<string>(modelValue.value ?? '');
+const v = ref<string>(modelValue.value ?? '');
+const focused = ref(false);
+const changed = ref(false);
+const inputEl = shallowRef<HTMLTextAreaElement>();
+
+const onInput = (ev) => {
+	v.value = ev.target?.value ?? v.value;
+	changed.value = true;
+	emit('change', ev);
+};
+
+const onKeydown = (ev: KeyboardEvent) => {
+	if (ev.isComposing || ev.key === 'Process' || ev.keyCode === 229) return;
+
+	emit('keydown', ev);
+
+	if (ev.code === 'Enter') {
+		const pos = inputEl.value?.selectionStart ?? 0;
+		const posEnd = inputEl.value?.selectionEnd ?? vModel.value.length;
+		if (pos === posEnd) {
+			const lines = vModel.value.slice(0, pos).split('\n');
+			const currentLine = lines[lines.length - 1];
+			const currentLineSpaces = currentLine.match(/^\s+/);
+			const posDelta = currentLineSpaces ? currentLineSpaces[0].length : 0;
+			ev.preventDefault();
+			vModel.value = vModel.value.slice(0, pos) + '\n' + (currentLineSpaces ? currentLineSpaces[0] : '') + vModel.value.slice(pos);
+			v.value = vModel.value;
+			nextTick(() => {
+				inputEl.value?.setSelectionRange(pos + 1 + posDelta, pos + 1 + posDelta);
+			});
+		}
+		emit('enter');
+	}
+
+	if (ev.key === 'Tab') {
+		const pos = inputEl.value?.selectionStart ?? 0;
+		const posEnd = inputEl.value?.selectionEnd ?? vModel.value.length;
+		vModel.value = vModel.value.slice(0, pos) + '\t' + vModel.value.slice(posEnd);
+		v.value = vModel.value;
+		nextTick(() => {
+			inputEl.value?.setSelectionRange(pos + 1, pos + 1);
+		});
+		ev.preventDefault();
+	}
+};
+
+const updated = () => {
+	changed.value = false;
+	emit('update:modelValue', v.value);
+};
+
+watch(modelValue, newValue => {
+	v.value = newValue ?? '';
+});
+
+watch(v, () => {
+	updated();
+});
+</script>
+
+<style lang="scss" module>
+.codeEditorRoot {
+	min-width: 100%;
+	max-width: 100%;
+	overflow-x: auto;
+	overflow-y: hidden;
+	box-sizing: border-box;
+	margin: 0;
+	padding: 0;
+	color: var(--fg);
+	border: solid 1px var(--panel);
+	transition: border-color 0.1s ease-out;
+	font-family: Consolas, Monaco, Andale Mono, Ubuntu Mono, monospace;
+	&:hover {
+		border-color: var(--inputBorderHover) !important;
+	}
+}
+
+.focused.codeEditorRoot {
+	border-color: var(--accent) !important;
+	border-radius: 6px;
+}
+
+.codeEditorScroller {
+	position: relative;
+	display: inline-block;
+	min-width: 100%;
+	height: 100%;
+}
+
+.textarea {
+	position: absolute;
+	top: 0;
+	left: 0;
+	right: 0;
+	bottom: 0;
+	display: inline-block;
+	appearance: none;
+	resize: none;
+	text-align: left;
+	color: transparent;
+	caret-color: rgb(225, 228, 232);
+	background-color: transparent;
+	border: 0;
+	outline: 0;
+	padding: 12px;
+	line-height: 1.5em;
+	font-size: 1em;
+	font-family: Consolas, Monaco, Andale Mono, Ubuntu Mono, monospace;
+}
+
+.textarea::selection {
+	color: #fff;
+}
+</style>
--- a/packages/frontend/src/components/MkDateSeparatedList.vue
+++ b/packages/frontend/src/components/MkDateSeparatedList.vue
@@ -42,6 +42,7 @@ export default defineComponent({

 	setup(props, { slots, expose }) {
 		const $style = useCssModule(); // カスタムレンダラなので使っても大丈夫
+
 		function getDateText(time: string) {
 			const date = new Date(time).getDate();
 			const month = new Date(time).getMonth() + 1;
@@ -121,6 +122,7 @@ export default defineComponent({
 			el.style.top = `${el.offsetTop}px`;
 			el.style.left = `${el.offsetLeft}px`;
 		}
+
 		function onLeaveCanceled(el: HTMLElement) {
 			el.style.top = '';
 			el.style.left = '';
--- a/packages/frontend/src/components/MkDialog.vue
+++ b/packages/frontend/src/components/MkDialog.vue
@@ -170,6 +170,7 @@ async function ok() {
 function cancel() {
 	done(true);
 }
+
 /*
 function onBgClick() {
 	if (props.cancelableByBgClick) cancel();
--- a/packages/frontend/src/components/MkDrive.file.vue
+++ b/packages/frontend/src/components/MkDrive.file.vue
@@ -47,6 +47,7 @@ import { i18n } from '@/i18n.js';
 import { $i } from '@/account.js';
 import { useRouter } from '@/router.js';
 import { getDriveFileMenu } from '@/scripts/get-drive-file-menu.js';
+import { deviceKind } from '@/scripts/device-kind.js';

 const router = useRouter();

@@ -74,7 +75,11 @@ function onClick(ev: MouseEvent) {
 	if (props.selectMode) {
 		emit('chosen', props.file);
 	} else {
-		router.push(`/my/drive/file/${props.file.id}`);
+		if (deviceKind === 'desktop') {
+			router.push(`/my/drive/file/${props.file.id}`);
+		} else {
+			os.popupMenu(getDriveFileMenu(props.file, props.folder), (ev.currentTarget ?? ev.target ?? undefined) as HTMLElement | undefined);
+		}
 	}
 }

--- a/packages/frontend/src/components/MkDrive.vue
+++ b/packages/frontend/src/components/MkDrive.vue
@@ -505,6 +505,7 @@ function appendFile(file: Misskey.entities.DriveFile) {
 function appendFolder(folderToAppend: Misskey.entities.DriveFolder) {
 	addFolder(folderToAppend);
 }
+
 /*
 function prependFile(file: Misskey.entities.DriveFile) {
 	addFile(file, true);
--- a/packages/frontend/src/components/MkEmojiPicker.vue
+++ b/packages/frontend/src/components/MkEmojiPicker.vue
@@ -5,7 +5,7 @@ SPDX-License-Identifier: AGPL-3.0-only

 <template>
 <div class="omfetrab" :class="['s' + size, 'w' + width, 'h' + height, { asDrawer, asWindow }]" :style="{ maxHeight: maxHeight ? maxHeight + 'px' : undefined }">
-	<input ref="searchEl" :value="q" class="search" data-prevent-emoji-insert :class="{ filled: q != null && q != '' }" :placeholder="i18n.ts.search" type="search" @input="input()" @paste.stop="paste" @keydown.stop.prevent.enter="onEnter">
+	<input ref="searchEl" :value="q" class="search" data-prevent-emoji-insert :class="{ filled: q != null && q != '' }" :placeholder="i18n.ts.search" type="search" autocapitalize="off" @input="input()" @paste.stop="paste" @keydown.stop.prevent.enter="onEnter">
 	<!-- FirefoxのTabフォーカスが想定外の挙動となるためtabindex="-1"を追加 https://github.com/misskey-dev/misskey/issues/10744 -->
 	<div ref="emojisEl" class="emojis" tabindex="-1">
 		<section class="result">
--- a/packages/frontend/src/components/MkFoldableSection.vue
+++ b/packages/frontend/src/components/MkFoldableSection.vue
@@ -84,6 +84,7 @@ onMounted(() => {
 			return getParentBg(el.parentElement);
 		}
 	}
+
 	const rawBg = getParentBg(el.value);
 	const _bg = tinycolor(rawBg.startsWith('var(') ? getComputedStyle(document.documentElement).getPropertyValue(rawBg.slice(4, -1)) : rawBg);
 	_bg.setAlpha(0.85);
--- a/packages/frontend/src/components/MkGoogle.vue
+++ b/packages/frontend/src/components/MkGoogle.vue
@@ -21,7 +21,9 @@ const props = defineProps<{
 const query = ref(props.q);

 const search = () => {
-	window.open(`https://www.google.com/search?q=${query.value}`, '_blank');
+	const sp = new URLSearchParams();
+	sp.append('q', query.value);
+	window.open(`https://www.google.com/search?${sp.toString()}`, '_blank');
 };
 </script>

--- a/packages/frontend/src/components/MkInfo.vue
+++ b/packages/frontend/src/components/MkInfo.vue
@@ -7,7 +7,8 @@ SPDX-License-Identifier: AGPL-3.0-only
 <div :class="[$style.root, { [$style.warn]: warn, [$style.rounded]: rounded }]">
 	<i v-if="warn" class="ti ti-alert-triangle" :class="$style.i"></i>
 	<i v-else class="ti ti-info-circle" :class="$style.i"></i>
-	<slot></slot>
+	<div><slot></slot></div>
+	<button v-if="closable" :class="$style.button" class="_button" @click="close()"><i class="ti ti-x"></i></button>
 </div>
 </template>

@@ -16,14 +17,26 @@ import { } from 'vue';

 const props = withDefaults(defineProps<{
 	warn?: boolean;
+	closable?: boolean;
 	rounded?: boolean;
 }>(), {
 	rounded: true,
 });
+
+const emit = defineEmits<{
+	(ev: 'close'): void;
+}>();
+
+function close() {
+	// こいつの中では非表示動作は行わない
+	emit('close');
+}
 </script>

 <style lang="scss" module>
 .root {
+	display: flex;
+  align-items: center;
 	padding: 12px 14px;
 	font-size: 90%;
 	background: var(--infoBg);
@@ -43,4 +56,9 @@ const props = withDefaults(defineProps<{
 .i {
 	margin-right: 4px;
 }
+
+.button {
+	margin-left: auto;
+	padding: 4px;
+}
 </style>
--- a/packages/frontend/src/components/MkInput.vue
+++ b/packages/frontend/src/components/MkInput.vue
@@ -12,7 +12,7 @@ SPDX-License-Identifier: AGPL-3.0-only
 			ref="inputEl"
 			v-model="v"
 			v-adaptive-border
-			:class="$style.inputCore"
+			:class="[$style.inputCore, { _monospace: code }]"
 			:type="type"
 			:disabled="disabled"
 			:required="required"
@@ -20,6 +20,7 @@ SPDX-License-Identifier: AGPL-3.0-only
 			:placeholder="placeholder"
 			:pattern="pattern"
 			:autocomplete="autocomplete"
+			:autocapitalize="autocapitalize"
 			:spellcheck="spellcheck"
 			:step="step"
 			:list="id"
@@ -58,6 +59,7 @@ const props = defineProps<{
 	placeholder?: string;
 	autofocus?: boolean;
 	autocomplete?: string;
+	autocapitalize?: string;
 	spellcheck?: boolean;
 	step?: any;
 	datalist?: string[];
@@ -68,6 +70,7 @@ const props = defineProps<{
 	manualSave?: boolean;
 	small?: boolean;
 	large?: boolean;
+	code?: boolean;
 }>();

 const emit = defineEmits<{
--- a/packages/frontend/src/components/MkLaunchPad.vue
+++ b/packages/frontend/src/components/MkLaunchPad.vue
@@ -7,16 +7,18 @@ SPDX-License-Identifier: AGPL-3.0-only
 <MkModal ref="modal" v-slot="{ type, maxHeight }" :preferType="preferedModalType" :anchor="anchor" :transparentBg="true" :src="src" @click="modal.close()" @closed="emit('closed')">
 	<div class="szkkfdyq _popup _shadow" :class="{ asDrawer: type === 'drawer' }" :style="{ maxHeight: maxHeight ? maxHeight + 'px' : '' }">
 		<div class="main">
-			<template v-for="item in items">
+			<template v-for="item in items" :key="item.text">
 				<button v-if="item.action" v-click-anime class="_button item" @click="$event => { item.action($event); close(); }">
 					<i class="icon" :class="item.icon"></i>
 					<div class="text">{{ item.text }}</div>
-					<span v-if="item.indicate" class="indicator"><i class="_indicatorCircle"></i></span>
+					<span v-if="item.indicate && item.indicateValue" class="_indicateCounter indicatorWithValue">{{ item.indicateValue }}</span>
+					<span v-else-if="item.indicate" class="indicator"><i class="_indicatorCircle"></i></span>
 				</button>
 				<MkA v-else v-click-anime :to="item.to" class="item" @click.passive="close()">
 					<i class="icon" :class="item.icon"></i>
 					<div class="text">{{ item.text }}</div>
-					<span v-if="item.indicate" class="indicator"><i class="_indicatorCircle"></i></span>
+					<span v-if="item.indicate && item.indicateValue" class="_indicateCounter indicatorWithValue">{{ item.indicateValue }}</span>
+					<span v-else-if="item.indicate" class="indicator"><i class="_indicatorCircle"></i></span>
 				</MkA>
 			</template>
 		</div>
@@ -27,7 +29,7 @@ SPDX-License-Identifier: AGPL-3.0-only
 <script lang="ts" setup>
 import { } from 'vue';
 import MkModal from '@/components/MkModal.vue';
-import { navbarItemDef } from '@/navbar';
+import { navbarItemDef } from '@/navbar.js';
 import { defaultStore } from '@/store.js';
 import { deviceKind } from '@/scripts/device-kind.js';

@@ -57,6 +59,7 @@ const items = Object.keys(navbarItemDef).filter(k => !menu.includes(k)).map(k =>
 	to: def.to,
 	action: def.action,
 	indicate: def.indicated,
+	indicateValue: def.indicateValue,
 }));

 function close() {
@@ -116,6 +119,17 @@ function close() {
 				line-height: 1.5em;
 			}

+			> .indicatorWithValue {
+				position: absolute;
+				top: 32px;
+				left: 16px;
+
+				@media (max-width: 500px) {
+					top: 16px;
+					left: 8px;
+				}
+			}
+
 			> .indicator {
 				position: absolute;
 				top: 32px;
--- a/packages/frontend/src/components/MkMediaBanner.vue
+++ b/packages/frontend/src/components/MkMediaBanner.vue
@@ -34,7 +34,6 @@ SPDX-License-Identifier: AGPL-3.0-only
 <script lang="ts" setup>
 import { onMounted, shallowRef, watch } from 'vue';
 import * as Misskey from 'misskey-js';
-import { soundConfigStore } from '@/scripts/sound.js';
 import { i18n } from '@/i18n.js';

 const props = withDefaults(defineProps<{
--- a/packages/frontend/src/components/MkMenu.vue
+++ b/packages/frontend/src/components/MkMenu.vue
@@ -145,11 +145,13 @@ const onGlobalMousedown = (event: MouseEvent) => {
 };

 let childCloseTimer: null | number = null;
+
 function onItemMouseEnter(item) {
 	childCloseTimer = window.setTimeout(() => {
 		closeChild();
 	}, 300);
 }
+
 function onItemMouseLeave(item) {
 	if (childCloseTimer) window.clearTimeout(childCloseTimer);
 }
--- a/packages/frontend/src/components/MkNote.vue
+++ b/packages/frontend/src/components/MkNote.vue
@@ -43,29 +43,38 @@ SPDX-License-Identifier: AGPL-3.0-only
 	</div>
 	<div v-if="renoteCollapsed" :class="$style.collapsedRenoteTarget">
 		<MkAvatar :class="$style.collapsedRenoteTargetAvatar" :user="appearNote.user" link preview/>
-		<Mfm :text="getNoteSummary(appearNote)" :plain="true" :nowrap="true" :author="appearNote.user" :class="$style.collapsedRenoteTargetText" @click="renoteCollapsed = false"/>
+		<Mfm :text="getNoteSummary(appearNote)" :plain="true" :nowrap="true" :author="appearNote.user" :nyaize="'account'" :class="$style.collapsedRenoteTargetText" @click="renoteCollapsed = false"/>
 	</div>
 	<article v-else :class="$style.article" @contextmenu.stop="onContextmenu">
 		<div v-if="appearNote.channel" :class="$style.colorBar" :style="{ background: appearNote.channel.color }"></div>
-		<MkAvatar :class="$style.avatar" :user="appearNote.user" link preview/>
+		<MkAvatar :class="$style.avatar" :user="appearNote.user" :link="!mock" :preview="!mock"/>
 		<div :class="$style.main">
 			<MkNoteHeader :note="appearNote" :mini="true"/>
 			<MkInstanceTicker v-if="showTicker" :instance="appearNote.user.instance"/>
 			<div style="container-type: inline-size;">
 				<p v-if="appearNote.cw != null" :class="$style.cw">
-					<Mfm v-if="appearNote.cw != ''" style="margin-right: 8px;" :text="appearNote.cw" :author="appearNote.user" :i="$i"/>
+					<Mfm v-if="appearNote.cw != ''" style="margin-right: 8px;" :text="appearNote.cw" :author="appearNote.user" :nyaize="'account'"/>
 					<MkCwButton v-model="showContent" :note="appearNote" style="margin: 4px 0;"/>
 				</p>
 				<div v-show="appearNote.cw == null || showContent" :class="[{ [$style.contentCollapsed]: collapsed }]">
 					<div :class="$style.text">
 						<span v-if="appearNote.isHidden" style="opacity: 0.5">({{ i18n.ts.private }})</span>
 						<MkA v-if="appearNote.replyId" :class="$style.replyIcon" :to="`/notes/${appearNote.replyId}`"><i class="ti ti-arrow-back-up"></i></MkA>
-						<Mfm v-if="appearNote.text" :text="appearNote.text" :author="appearNote.user" :i="$i" :emojiUrls="appearNote.emojis"/>
+						<Mfm
+							v-if="appearNote.text"
+							:parsedNodes="parsed"
+							:text="appearNote.text"
+							:author="appearNote.user"
+							:nyaize="'account'"
+							:emojiUrls="appearNote.emojis"
+							:enableEmojiMenu="true"
+							:enableEmojiMenuReaction="true"
+						/>
 						<div v-if="translating || translation" :class="$style.translation">
 							<MkLoading v-if="translating" mini/>
 							<div v-else>
 								<b>{{ i18n.t('translatedFrom', { x: translation.sourceLang }) }}: </b>
-								<Mfm :text="translation.text" :author="appearNote.user" :i="$i" :emojiUrls="appearNote.emojis"/>
+								<Mfm :text="translation.text" :author="appearNote.user" :nyaize="'account'" :emojiUrls="appearNote.emojis"/>
 							</div>
 						</div>
 					</div>
@@ -84,7 +93,7 @@ SPDX-License-Identifier: AGPL-3.0-only
 				</div>
 				<MkA v-if="appearNote.channel && !inChannel" :class="$style.channel" :to="`/channels/${appearNote.channel.id}`"><i class="ti ti-device-tv"></i> {{ appearNote.channel.name }}</MkA>
 			</div>
-			<MkReactionsViewer :note="appearNote" :maxNumber="16">
+			<MkReactionsViewer :note="appearNote" :maxNumber="16" @mockUpdateMyReaction="emitUpdReaction">
 				<template #more>
 					<div :class="$style.reactionOmitted">{{ i18n.ts.more }}</div>
 				</template>
@@ -136,7 +145,7 @@ SPDX-License-Identifier: AGPL-3.0-only
 </template>

 <script lang="ts" setup>
-import { computed, inject, onMounted, ref, shallowRef, Ref, defineAsyncComponent } from 'vue';
+import { computed, inject, onMounted, ref, shallowRef, Ref, defineAsyncComponent, watch, provide } from 'vue';
 import * as mfm from 'mfm-js';
 import * as Misskey from 'misskey-js';
 import MkNoteSub from '@/components/MkNoteSub.vue';
@@ -159,7 +168,7 @@ import { reactionPicker } from '@/scripts/reaction-picker.js';
 import { extractUrlFromMfm } from '@/scripts/extract-url-from-mfm.js';
 import { $i } from '@/account.js';
 import { i18n } from '@/i18n.js';
-import { getAbuseNoteMenu, getCopyNoteLinkMenu, getNoteClipMenu, getNoteMenu } from '@/scripts/get-note-menu.js';
+import { getAbuseNoteMenu, getCopyNoteLinkMenu, getNoteClipMenu, getNoteMenu, getRenoteMenu } from '@/scripts/get-note-menu.js';
 import { useNoteCapture } from '@/scripts/use-note-capture.js';
 import { deepClone } from '@/scripts/clone.js';
 import { useTooltip } from '@/scripts/use-tooltip.js';
@@ -170,9 +179,19 @@ import MkRippleEffect from '@/components/MkRippleEffect.vue';
 import { showMovedDialog } from '@/scripts/show-moved-dialog.js';
 import { shouldCollapsed } from '@/scripts/collapsed.js';

-const props = defineProps<{
+const props = withDefaults(defineProps<{
 	note: Misskey.entities.Note;
 	pinned?: boolean;
+	mock?: boolean;
+}>(), {
+	mock: false,
+});
+
+provide('mock', props.mock);
+
+const emit = defineEmits<{
+	(ev: 'reaction', emoji: string): void;
+	(ev: 'removeReaction', emoji: string): void;
 }>();

 const inChannel = inject('inChannel', null);
@@ -183,9 +202,11 @@ let note = $ref(deepClone(props.note));
 // plugin
 if (noteViewInterruptors.length > 0) {
 	onMounted(async () => {
-		let result = deepClone(note);
+		let result:Misskey.entities.Note | null = deepClone(note);
 		for (const interruptor of noteViewInterruptors) {
 			result = await interruptor.handler(result);
+
+			if (result === null) return isDeleted.value = true;
 		}
 		note = result;
 	});
@@ -207,8 +228,9 @@ const clipButton = shallowRef<HTMLElement>();
 let appearNote = $computed(() => isRenote ? note.renote as Misskey.entities.Note : note);
 const isMyRenote = $i && ($i.id === note.userId);
 const showContent = ref(false);
-const urls = appearNote.text ? extractUrlFromMfm(mfm.parse(appearNote.text)) : null;
-const isLong = shouldCollapsed(appearNote);
+const parsed = appearNote.text ? mfm.parse(appearNote.text) : null;
+const urls = parsed ? extractUrlFromMfm(parsed) : null;
+const isLong = shouldCollapsed(appearNote, urls ?? []);
 const collapsed = ref(appearNote.cw == null && isLong);
 const isDeleted = ref(false);
 const muted = ref($i ? checkWordMute(appearNote, $i, $i.mutedWords) : false);
@@ -229,126 +251,61 @@ const keymap = {
 	's': () => showContent.value !== showContent.value,
 };

-useNoteCapture({
-	rootEl: el,
-	note: $$(appearNote),
-	pureNote: $$(note),
-	isDeletedRef: isDeleted,
-});
-
-useTooltip(renoteButton, async (showing) => {
-	const renotes = await os.api('notes/renotes', {
+provide('react', (reaction: string) => {
+	os.api('notes/reactions/create', {
 		noteId: appearNote.id,
-		limit: 11,
+		reaction: reaction,
 	});
-
-	const users = renotes.map(x => x.user);
-
-	if (users.length < 1) return;
-
-	os.popup(MkUsersTooltip, {
-		showing,
-		users,
-		count: appearNote.renoteCount,
-		targetElement: renoteButton.value,
-	}, {}, 'closed');
 });

-type Visibility = 'public' | 'home' | 'followers' | 'specified';
+if (props.mock) {
+	watch(() => props.note, (to) => {
+		note = deepClone(to);
+	}, { deep: true });
+} else {
+	useNoteCapture({
+		rootEl: el,
+		note: $$(appearNote),
+		pureNote: $$(note),
+		isDeletedRef: isDeleted,
+	});
+}

-// defaultStore.state.visibilityがstringなためstringも受け付けている
-function smallerVisibility(a: Visibility | string, b: Visibility | string): Visibility {
-	if (a === 'specified' || b === 'specified') return 'specified';
-	if (a === 'followers' || b === 'followers') return 'followers';
-	if (a === 'home' || b === 'home') return 'home';
-	// if (a === 'public' || b === 'public')
-	return 'public';
+if (!props.mock) {
+	useTooltip(renoteButton, async (showing) => {
+		const renotes = await os.api('notes/renotes', {
+			noteId: appearNote.id,
+			limit: 11,
+		});
+
+		const users = renotes.map(x => x.user);
+
+		if (users.length < 1) return;
+
+		os.popup(MkUsersTooltip, {
+			showing,
+			users,
+			count: appearNote.renoteCount,
+			targetElement: renoteButton.value,
+		}, {}, 'closed');
+	});
 }

 function renote(viaKeyboard = false) {
 	pleaseLogin();
 	showMovedDialog();

-	let items = [] as MenuItem[];
-
-	if (appearNote.channel) {
-		items = items.concat([{
-			text: i18n.ts.inChannelRenote,
-			icon: 'ti ti-repeat',
-			action: () => {
-				const el = renoteButton.value as HTMLElement | null | undefined;
-				if (el) {
-					const rect = el.getBoundingClientRect();
-					const x = rect.left + (el.offsetWidth / 2);
-					const y = rect.top + (el.offsetHeight / 2);
-					os.popup(MkRippleEffect, { x, y }, {}, 'end');
-				}
-
-				os.api('notes/create', {
-					renoteId: appearNote.id,
-					channelId: appearNote.channelId,
-				}).then(() => {
-					os.toast(i18n.ts.renoted);
-				});
-			},
-		}, {
-			text: i18n.ts.inChannelQuote,
-			icon: 'ti ti-quote',
-			action: () => {
-				os.post({
-					renote: appearNote,
-					channel: appearNote.channel,
-				});
-			},
-		}, null]);
-	}
-
-	items = items.concat([{
-		text: i18n.ts.renote,
-		icon: 'ti ti-repeat',
-		action: () => {
-			const el = renoteButton.value as HTMLElement | null | undefined;
-			if (el) {
-				const rect = el.getBoundingClientRect();
-				const x = rect.left + (el.offsetWidth / 2);
-				const y = rect.top + (el.offsetHeight / 2);
-				os.popup(MkRippleEffect, { x, y }, {}, 'end');
-			}
-
-			const configuredVisibility = defaultStore.state.rememberNoteVisibility ? defaultStore.state.visibility : defaultStore.state.defaultNoteVisibility;
-			const localOnly = defaultStore.state.rememberNoteVisibility ? defaultStore.state.localOnly : defaultStore.state.defaultNoteLocalOnly;
-
-			let visibility = appearNote.visibility;
-			visibility = smallerVisibility(visibility, configuredVisibility);
-			if (appearNote.channel?.isSensitive) {
-				visibility = smallerVisibility(visibility, 'home');
-			}
-
-			os.api('notes/create', {
-				localOnly,
-				visibility,
-				renoteId: appearNote.id,
-			}).then(() => {
-				os.toast(i18n.ts.renoted);
-			});
-		},
-	}, {
-		text: i18n.ts.quote,
-		icon: 'ti ti-quote',
-		action: () => {
-			os.post({
-				renote: appearNote,
-			});
-		},
-	}]);
-
-	os.popupMenu(items, renoteButton.value, {
+	const { menu } = getRenoteMenu({ note: note, renoteButton, mock: props.mock });
+	os.popupMenu(menu, renoteButton.value, {
 		viaKeyboard,
-	});
+	}).then(focus);
 }

 function reply(viaKeyboard = false): void {
 	pleaseLogin();
+	if (props.mock) {
+		return;
+	}
 	os.post({
 		reply: appearNote,
 		channel: appearNote.channel,
@@ -362,6 +319,10 @@ function react(viaKeyboard = false): void {
 	pleaseLogin();
 	showMovedDialog();
 	if (appearNote.reactionAcceptance === 'likeOnly') {
+		if (props.mock) {
+			return;
+		}
+
 		os.api('notes/reactions/create', {
 			noteId: appearNote.id,
 			reaction: '❤️',
@@ -376,6 +337,11 @@ function react(viaKeyboard = false): void {
 	} else {
 		blur();
 		reactionPicker.show(reactButton.value, reaction => {
+			if (props.mock) {
+				emit('reaction', reaction);
+				return;
+			}
+
 			os.api('notes/reactions/create', {
 				noteId: appearNote.id,
 				reaction: reaction,
@@ -392,12 +358,22 @@ function react(viaKeyboard = false): void {
 function undoReact(note): void {
 	const oldReaction = note.myReaction;
 	if (!oldReaction) return;
+
+	if (props.mock) {
+		emit('removeReaction', oldReaction);
+		return;
+	}
+
 	os.api('notes/reactions/delete', {
 		noteId: note.id,
 	});
 }

 function onContextmenu(ev: MouseEvent): void {
+	if (props.mock) {
+		return;
+	}
+
 	const isLink = (el: HTMLElement) => {
 		if (el.tagName === 'A') return true;
 		// 再生速度の選択などのために、Audio要素のコンテキストメニューはブラウザデフォルトとする。
@@ -419,6 +395,10 @@ function onContextmenu(ev: MouseEvent): void {
 }

 function menu(viaKeyboard = false): void {
+	if (props.mock) {
+		return;
+	}
+
 	const { menu, cleanup } = getNoteMenu({ note: note, translating, translation, menuButton, isDeleted, currentClip: currentClip?.value });
 	os.popupMenu(menu, menuButton.value, {
 		viaKeyboard,
@@ -426,10 +406,18 @@ function menu(viaKeyboard = false): void {
 }

 async function clip() {
+	if (props.mock) {
+		return;
+	}
+
 	os.popupMenu(await getNoteClipMenu({ note: note, isDeleted, currentClip: currentClip?.value }), clipButton.value).then(focus);
 }

 function showRenoteMenu(viaKeyboard = false): void {
+	if (props.mock) {
+		return;
+	}
+
 	function getUnrenote(): MenuItem {
 		return {
 			text: i18n.ts.unrenote,
@@ -487,6 +475,14 @@ function readPromo() {
 	});
 	isDeleted.value = true;
 }
+
+function emitUpdReaction(emoji: string, delta: number) {
+	if (delta < 0) {
+		emit('removeReaction', emoji);
+	} else if (delta > 0) {
+		emit('reaction', emoji);
+	}
+}
 </script>

 <style lang="scss" module>
--- a/packages/frontend/src/components/MkNoteDetailed.vue
+++ b/packages/frontend/src/components/MkNoteDetailed.vue
@@ -67,19 +67,28 @@ SPDX-License-Identifier: AGPL-3.0-only
 		</header>
 		<div :class="$style.noteContent">
 			<p v-if="appearNote.cw != null" :class="$style.cw">
-				<Mfm v-if="appearNote.cw != ''" style="margin-right: 8px;" :text="appearNote.cw" :author="appearNote.user" :i="$i"/>
+				<Mfm v-if="appearNote.cw != ''" style="margin-right: 8px;" :text="appearNote.cw" :author="appearNote.user" :nyaize="'account'"/>
 				<MkCwButton v-model="showContent" :note="appearNote"/>
 			</p>
 			<div v-show="appearNote.cw == null || showContent">
 				<span v-if="appearNote.isHidden" style="opacity: 0.5">({{ i18n.ts.private }})</span>
 				<MkA v-if="appearNote.replyId" :class="$style.noteReplyTarget" :to="`/notes/${appearNote.replyId}`"><i class="ti ti-arrow-back-up"></i></MkA>
-				<Mfm v-if="appearNote.text" :text="appearNote.text" :author="appearNote.user" :i="$i" :emojiUrls="appearNote.emojis"/>
+				<Mfm
+					v-if="appearNote.text"
+					:parsedNodes="parsed"
+					:text="appearNote.text"
+					:author="appearNote.user"
+					:nyaize="'account'"
+					:emojiUrls="appearNote.emojis"
+					:enableEmojiMenu="true"
+					:enableEmojiMenuReaction="true"
+				/>
 				<a v-if="appearNote.renote != null" :class="$style.rn">RN:</a>
 				<div v-if="translating || translation" :class="$style.translation">
 					<MkLoading v-if="translating" mini/>
 					<div v-else>
 						<b>{{ i18n.t('translatedFrom', { x: translation.sourceLang }) }}: </b>
-						<Mfm :text="translation.text" :author="appearNote.user" :i="$i" :emojiUrls="appearNote.emojis"/>
+						<Mfm :text="translation.text" :author="appearNote.user" :nyaize="'account'" :emojiUrls="appearNote.emojis"/>
 					</div>
 				</div>
 				<div v-if="appearNote.files.length > 0">
@@ -184,7 +193,7 @@ SPDX-License-Identifier: AGPL-3.0-only
 </template>

 <script lang="ts" setup>
-import { computed, inject, onMounted, ref, shallowRef } from 'vue';
+import { computed, inject, onMounted, provide, ref, shallowRef } from 'vue';
 import * as mfm from 'mfm-js';
 import * as Misskey from 'misskey-js';
 import MkNoteSub from '@/components/MkNoteSub.vue';
@@ -206,7 +215,7 @@ import { reactionPicker } from '@/scripts/reaction-picker.js';
 import { extractUrlFromMfm } from '@/scripts/extract-url-from-mfm.js';
 import { $i } from '@/account.js';
 import { i18n } from '@/i18n.js';
-import { getNoteClipMenu, getNoteMenu } from '@/scripts/get-note-menu.js';
+import { getNoteClipMenu, getNoteMenu, getRenoteMenu } from '@/scripts/get-note-menu.js';
 import { useNoteCapture } from '@/scripts/use-note-capture.js';
 import { deepClone } from '@/scripts/clone.js';
 import { useTooltip } from '@/scripts/use-tooltip.js';
@@ -230,9 +239,11 @@ let note = $ref(deepClone(props.note));
 // plugin
 if (noteViewInterruptors.length > 0) {
 	onMounted(async () => {
-		let result = deepClone(note);
+		let result:Misskey.entities.Note | null = deepClone(note);
 		for (const interruptor of noteViewInterruptors) {
 			result = await interruptor.handler(result);
+
+			if (result === null) return isDeleted.value = true;
 		}
 		note = result;
 	});
@@ -258,7 +269,8 @@ const isDeleted = ref(false);
 const muted = ref($i ? checkWordMute(appearNote, $i, $i.mutedWords) : false);
 const translation = ref(null);
 const translating = ref(false);
-const urls = appearNote.text ? extractUrlFromMfm(mfm.parse(appearNote.text)) : null;
+const parsed = appearNote.text ? mfm.parse(appearNote.text) : null;
+const urls = parsed ? extractUrlFromMfm(parsed) : null;
 const showTicker = (defaultStore.state.instanceTicker === 'always') || (defaultStore.state.instanceTicker === 'remote' && appearNote.user.instance);
 const conversation = ref<Misskey.entities.Note[]>([]);
 const replies = ref<Misskey.entities.Note[]>([]);
@@ -273,6 +285,13 @@ const keymap = {
 	's': () => showContent.value !== showContent.value,
 };

+provide('react', (reaction: string) => {
+	os.api('notes/reactions/create', {
+		noteId: appearNote.id,
+		reaction: reaction,
+	});
+});
+
 let tab = $ref('replies');
 let reactionTabType = $ref(null);

@@ -322,71 +341,10 @@ function renote(viaKeyboard = false) {
 	pleaseLogin();
 	showMovedDialog();

-	let items = [] as MenuItem[];
-
-	if (appearNote.channel) {
-		items = items.concat([{
-			text: i18n.ts.inChannelRenote,
-			icon: 'ti ti-repeat',
-			action: () => {
-				const el = renoteButton.value as HTMLElement | null | undefined;
-				if (el) {
-					const rect = el.getBoundingClientRect();
-					const x = rect.left + (el.offsetWidth / 2);
-					const y = rect.top + (el.offsetHeight / 2);
-					os.popup(MkRippleEffect, { x, y }, {}, 'end');
-				}
-
-				os.api('notes/create', {
-					renoteId: appearNote.id,
-					channelId: appearNote.channelId,
-				}).then(() => {
-					os.toast(i18n.ts.renoted);
-				});
-			},
-		}, {
-			text: i18n.ts.inChannelQuote,
-			icon: 'ti ti-quote',
-			action: () => {
-				os.post({
-					renote: appearNote,
-					channel: appearNote.channel,
-				});
-			},
-		}, null]);
-	}
-
-	items = items.concat([{
-		text: i18n.ts.renote,
-		icon: 'ti ti-repeat',
-		action: () => {
-			const el = renoteButton.value as HTMLElement | null | undefined;
-			if (el) {
-				const rect = el.getBoundingClientRect();
-				const x = rect.left + (el.offsetWidth / 2);
-				const y = rect.top + (el.offsetHeight / 2);
-				os.popup(MkRippleEffect, { x, y }, {}, 'end');
-			}
-
-			os.api('notes/create', {
-				renoteId: appearNote.id,
-			}).then(() => {
-				os.toast(i18n.ts.renoted);
-			});
-		},
-	}, {
-		text: i18n.ts.quote,
-		icon: 'ti ti-quote',
-		action: () => {
-			os.post({
-				renote: appearNote,
-			});
-		},
-	}]);
-
-	os.popupMenu(items, renoteButton.value, {
+	const { menu } = getRenoteMenu({ note: note, renoteButton });
+	os.popupMenu(menu, renoteButton.value, {
 		viaKeyboard,
-	});
+	}).then(focus);
 }

 function reply(viaKeyboard = false): void {
@@ -497,6 +455,7 @@ function blur() {
 }

 const repliesLoaded = ref(false);
+
 function loadReplies() {
 	repliesLoaded.value = true;
 	os.api('notes/children', {
@@ -508,6 +467,7 @@ function loadReplies() {
 }

 const conversationLoaded = ref(false);
+
 function loadConversation() {
 	conversationLoaded.value = true;
 	os.api('notes/conversation', {
--- a/packages/frontend/src/components/MkNoteHeader.vue
+++ b/packages/frontend/src/components/MkNoteHeader.vue
@@ -5,7 +5,10 @@ SPDX-License-Identifier: AGPL-3.0-only

 <template>
 <header :class="$style.root">
-	<MkA v-user-preview="note.user.id" :class="$style.name" :to="userPage(note.user)">
+	<div v-if="mock" :class="$style.name">
+		<MkUserName :user="note.user"/>
+	</div>
+	<MkA v-else v-user-preview="note.user.id" :class="$style.name" :to="userPage(note.user)">
 		<MkUserName :user="note.user"/>
 	</MkA>
 	<div v-if="note.user.isBot" :class="$style.isBot">bot</div>
@@ -14,7 +17,10 @@ SPDX-License-Identifier: AGPL-3.0-only
 		<img v-for="role in note.user.badgeRoles" :key="role.id" v-tooltip="role.name" :class="$style.badgeRole" :src="role.iconUrl"/>
 	</div>
 	<div :class="$style.info">
-		<MkA :to="notePage(note)">
+		<div v-if="mock">
+			<MkTime :time="note.createdAt" colored/>
+		</div>
+		<MkA v-else :to="notePage(note)">
 			<MkTime :time="note.createdAt" colored/>
 		</MkA>
 		<span v-if="note.visibility !== 'public'" style="margin-left: 0.5em;" :title="i18n.ts._visibility[note.visibility]">
@@ -29,7 +35,7 @@ SPDX-License-Identifier: AGPL-3.0-only
 </template>

 <script lang="ts" setup>
-import { } from 'vue';
+import { inject } from 'vue';
 import * as Misskey from 'misskey-js';
 import { i18n } from '@/i18n.js';
 import { notePage } from '@/filters/note.js';
@@ -38,6 +44,8 @@ import { userPage } from '@/filters/user.js';
 defineProps<{
 	note: Misskey.entities.Note;
 }>();
+
+const mock = inject<boolean>('mock', false);
 </script>

 <style lang="scss" module>
--- a/packages/frontend/src/components/MkNotePreview.vue
+++ b/packages/frontend/src/components/MkNotePreview.vue
@@ -5,14 +5,14 @@ SPDX-License-Identifier: AGPL-3.0-only

 <template>
 <div :class="$style.root">
-	<MkAvatar :class="$style.avatar" :user="$i" link preview/>
+	<MkAvatar :class="$style.avatar" :user="user" link preview/>
 	<div :class="$style.main">
 		<div :class="$style.header">
-			<MkUserName :user="$i" :nowrap="true"/>
+			<MkUserName :user="user" :nowrap="true"/>
 		</div>
 		<div>
 			<div>
-				<Mfm :text="text.trim()" :author="$i" :i="$i"/>
+				<Mfm :text="text.trim()" :author="user" :nyaize="'account'" :i="user"/>
 			</div>
 		</div>
 	</div>
@@ -21,10 +21,11 @@ SPDX-License-Identifier: AGPL-3.0-only

 <script lang="ts" setup>
 import { } from 'vue';
-import { $i } from '@/account.js';
+import * as Misskey from 'misskey-js';

 const props = defineProps<{
 	text: string;
+	user: Misskey.entities.User;
 }>();
 </script>

--- a/packages/frontend/src/components/MkNoteSimple.vue
+++ b/packages/frontend/src/components/MkNoteSimple.vue
@@ -10,7 +10,7 @@ SPDX-License-Identifier: AGPL-3.0-only
 		<MkNoteHeader :class="$style.header" :note="note" :mini="true"/>
 		<div>
 			<p v-if="note.cw != null" :class="$style.cw">
-				<Mfm v-if="note.cw != ''" style="margin-right: 8px;" :text="note.cw" :author="note.user" :i="$i" :emojiUrls="note.emojis"/>
+				<Mfm v-if="note.cw != ''" style="margin-right: 8px;" :text="note.cw" :author="note.user" :nyaize="'account'" :emojiUrls="note.emojis"/>
 				<MkCwButton v-model="showContent" :note="note"/>
 			</p>
 			<div v-show="note.cw == null || showContent">
--- a/packages/frontend/src/components/MkNoteSub.vue
+++ b/packages/frontend/src/components/MkNoteSub.vue
@@ -12,7 +12,7 @@ SPDX-License-Identifier: AGPL-3.0-only
 			<MkNoteHeader :class="$style.header" :note="note" :mini="true"/>
 			<div>
 				<p v-if="note.cw != null" :class="$style.cw">
-					<Mfm v-if="note.cw != ''" style="margin-right: 8px;" :text="note.cw" :author="note.user" :i="$i"/>
+					<Mfm v-if="note.cw != ''" style="margin-right: 8px;" :text="note.cw" :author="note.user" :nyaize="'account'"/>
 					<MkCwButton v-model="showContent" :note="note"/>
 				</p>
 				<div v-show="note.cw == null || showContent">
--- a/packages/frontend/src/components/MkNotification.vue
+++ b/packages/frontend/src/components/MkNotification.vue
@@ -4,14 +4,16 @@ SPDX-License-Identifier: AGPL-3.0-only
 -->

 <template>
-<div ref="elRef" :class="$style.root">
+<div :class="$style.root">
 	<div :class="$style.head">
 		<MkAvatar v-if="notification.type === 'pollEnded'" :class="$style.icon" :user="notification.note.user" link preview/>
 		<MkAvatar v-else-if="notification.type === 'note'" :class="$style.icon" :user="notification.note.user" link preview/>
 		<MkAvatar v-else-if="notification.type === 'achievementEarned'" :class="$style.icon" :user="$i" link preview/>
+		<div v-else-if="notification.type === 'reaction:grouped'" :class="[$style.icon, $style.icon_reactionGroup]"><i class="ti ti-plus" style="line-height: 1;"></i></div>
+		<div v-else-if="notification.type === 'renote:grouped'" :class="[$style.icon, $style.icon_renoteGroup]"><i class="ti ti-repeat" style="line-height: 1;"></i></div>
 		<img v-else-if="notification.type === 'test'" :class="$style.icon" :src="infoImageUrl"/>
 		<MkAvatar v-else-if="notification.user" :class="$style.icon" :user="notification.user" link preview/>
-		<img v-else-if="notification.icon" :class="$style.icon" :src="notification.icon" alt=""/>
+		<img v-else-if="notification.icon" :class="[$style.icon, $style.icon_app]" :src="notification.icon" alt=""/>
 		<div
 			:class="[$style.subIcon, {
 				[$style.t_follow]: notification.type === 'follow',
@@ -37,9 +39,8 @@ SPDX-License-Identifier: AGPL-3.0-only
 			<!-- notification.reaction が null になることはまずないが、ここでoptional chaining使うと一部ブラウザで刺さるので念の為 -->
 			<MkReactionIcon
 				v-else-if="notification.type === 'reaction'"
-				ref="reactionRef"
+				:withTooltip="true"
 				:reaction="notification.reaction ? notification.reaction.replace(/^:(\w+):$/, ':$1@.:') : notification.reaction"
-				:customEmojis="notification.note.emojis"
 				:noStyle="true"
 				style="width: 100%; height: 100%;"
 			/>
@@ -52,16 +53,18 @@ SPDX-License-Identifier: AGPL-3.0-only
 			<span v-else-if="notification.type === 'achievementEarned'">{{ i18n.ts._notification.achievementEarned }}</span>
 			<span v-else-if="notification.type === 'test'">{{ i18n.ts._notification.testNotification }}</span>
 			<MkA v-else-if="notification.user" v-user-preview="notification.user.id" :class="$style.headerName" :to="userPage(notification.user)"><MkUserName :user="notification.user"/></MkA>
+			<span v-else-if="notification.type === 'reaction:grouped'">{{ i18n.t('_notification.reactedBySomeUsers', { n: notification.reactions.length }) }}</span>
+			<span v-else-if="notification.type === 'renote:grouped'">{{ i18n.t('_notification.renotedBySomeUsers', { n: notification.users.length }) }}</span>
 			<span v-else>{{ notification.header }}</span>
 			<MkTime v-if="withTime" :time="notification.createdAt" :class="$style.headerTime"/>
 		</header>
 		<div>
-			<MkA v-if="notification.type === 'reaction'" :class="$style.text" :to="notePage(notification.note)" :title="getNoteSummary(notification.note)">
+			<MkA v-if="notification.type === 'reaction' || notification.type === 'reaction:grouped'" :class="$style.text" :to="notePage(notification.note)" :title="getNoteSummary(notification.note)">
 				<i class="ti ti-quote" :class="$style.quote"></i>
 				<Mfm :text="getNoteSummary(notification.note)" :plain="true" :nowrap="true" :author="notification.note.user"/>
 				<i class="ti ti-quote" :class="$style.quote"></i>
 			</MkA>
-			<MkA v-else-if="notification.type === 'renote'" :class="$style.text" :to="notePage(notification.note)" :title="getNoteSummary(notification.note.renote)">
+			<MkA v-else-if="notification.type === 'renote' || notification.type === 'renote:grouped'" :class="$style.text" :to="notePage(notification.note)" :title="getNoteSummary(notification.note.renote)">
 				<i class="ti ti-quote" :class="$style.quote"></i>
 				<Mfm :text="getNoteSummary(notification.note.renote)" :plain="true" :nowrap="true" :author="notification.note.renote.user"/>
 				<i class="ti ti-quote" :class="$style.quote"></i>
@@ -102,6 +105,25 @@ SPDX-License-Identifier: AGPL-3.0-only
 			<span v-else-if="notification.type === 'app'" :class="$style.text">
 				<Mfm :text="notification.body" :nowrap="false"/>
 			</span>
+
+			<div v-if="notification.type === 'reaction:grouped'">
+				<div v-for="reaction of notification.reactions" :class="$style.reactionsItem">
+					<MkAvatar :class="$style.reactionsItemAvatar" :user="reaction.user" link preview/>
+					<div :class="$style.reactionsItemReaction">
+						<MkReactionIcon
+							:withTooltip="true"
+							:reaction="reaction.reaction ? reaction.reaction.replace(/^:(\w+):$/, ':$1@.:') : reaction.reaction"
+							:noStyle="true"
+							style="width: 100%; height: 100%;"
+						/>
+					</div>
+				</div>
+			</div>
+			<div v-else-if="notification.type === 'renote:grouped'">
+				<div v-for="user of notification.users" :class="$style.reactionsItem">
+					<MkAvatar :class="$style.reactionsItemAvatar" :user="user" link preview/>
+				</div>
+			</div>
 		</div>
 	</div>
 </div>
@@ -112,14 +134,12 @@ import { ref, shallowRef } from 'vue';
 import * as Misskey from 'misskey-js';
 import MkReactionIcon from '@/components/MkReactionIcon.vue';
 import MkFollowButton from '@/components/MkFollowButton.vue';
-import XReactionTooltip from '@/components/MkReactionTooltip.vue';
 import MkButton from '@/components/MkButton.vue';
 import { getNoteSummary } from '@/scripts/get-note-summary.js';
 import { notePage } from '@/filters/note.js';
 import { userPage } from '@/filters/user.js';
 import { i18n } from '@/i18n.js';
 import * as os from '@/os.js';
-import { useTooltip } from '@/scripts/use-tooltip.js';
 import { $i } from '@/account.js';
 import { infoImageUrl } from '@/instance.js';

@@ -132,9 +152,6 @@ const props = withDefaults(defineProps<{
 	full: false,
 });

-const elRef = shallowRef<HTMLElement>(null);
-const reactionRef = ref(null);
-
 const followRequestDone = ref(false);

 const acceptFollowRequest = () => {
@@ -146,15 +163,6 @@ const rejectFollowRequest = () => {
 	followRequestDone.value = true;
 	os.api('following/requests/reject', { userId: props.notification.user.id });
 };
-
-useTooltip(reactionRef, (showing) => {
-	os.popup(XReactionTooltip, {
-		showing,
-		reaction: props.notification.reaction ? props.notification.reaction.replace(/^:(\w+):$/, ':$1@.:') : props.notification.reaction,
-		emojis: props.notification.note.emojis,
-		targetElement: reactionRef.value.$el,
-	}, {}, 'closed');
-});
 </script>

 <style lang="scss" module>
@@ -181,6 +189,29 @@ useTooltip(reactionRef, (showing) => {
 	display: block;
 	width: 100%;
 	height: 100%;
+}
+
+.icon_reactionGroup,
+.icon_renoteGroup {
+	display: grid;
+	align-items: center;
+	justify-items: center;
+	width: 80%;
+	height: 80%;
+	font-size: 15px;
+	border-radius: 100%;
+	color: #fff;
+}
+
+.icon_reactionGroup {
+	background: #e99a0b;
+}
+
+.icon_renoteGroup {
+	background: #36d298;
+}
+
+.icon_app {
 	border-radius: 6px;
 }

@@ -305,6 +336,36 @@ useTooltip(reactionRef, (showing) => {
 	flex: 1;
 }

+.reactionsItem {
+	display: inline-block;
+	position: relative;
+	width: 38px;
+	height: 38px;
+	margin-top: 8px;
+	margin-right: 8px;
+}
+
+.reactionsItemAvatar {
+	width: 100%;
+	height: 100%;
+}
+
+.reactionsItemReaction {
+	position: absolute;
+	z-index: 1;
+	bottom: -2px;
+	right: -2px;
+	width: 20px;
+	height: 20px;
+	box-sizing: border-box;
+	border-radius: 100%;
+	background: var(--panel);
+	box-shadow: 0 0 0 3px var(--panel);
+	font-size: 11px;
+	text-align: center;
+	color: #fff;
+}
+
@container (max-width: 600px) {
 	.root {
 		padding: 16px;
--- a/packages/frontend/src/components/MkNotifications.vue
+++ b/packages/frontend/src/components/MkNotifications.vue
@@ -4,25 +4,27 @@ SPDX-License-Identifier: AGPL-3.0-only
 -->

 <template>
-<MkPagination ref="pagingComponent" :pagination="pagination">
-	<template #empty>
-		<div class="_fullinfo">
-			<img :src="infoImageUrl" class="_ghost"/>
-			<div>{{ i18n.ts.noNotifications }}</div>
-		</div>
-	</template>
+<MkPullToRefresh :refresher="() => reload()">
+	<MkPagination ref="pagingComponent" :pagination="pagination">
+		<template #empty>
+			<div class="_fullinfo">
+				<img :src="infoImageUrl" class="_ghost"/>
+				<div>{{ i18n.ts.noNotifications }}</div>
+			</div>
+		</template>

-	<template #default="{ items: notifications }">
-		<MkDateSeparatedList v-slot="{ item: notification }" :class="$style.list" :items="notifications" :noGap="true">
-			<MkNote v-if="['reply', 'quote', 'mention'].includes(notification.type)" :key="notification.id" :note="notification.note"/>
-			<XNotification v-else :key="notification.id" :notification="notification" :withTime="true" :full="true" class="_panel notification"/>
-		</MkDateSeparatedList>
-	</template>
-</MkPagination>
+		<template #default="{ items: notifications }">
+			<MkDateSeparatedList v-slot="{ item: notification }" :class="$style.list" :items="notifications" :noGap="true">
+				<MkNote v-if="['reply', 'quote', 'mention'].includes(notification.type)" :key="notification.id" :note="notification.note"/>
+				<XNotification v-else :key="notification.id" :notification="notification" :withTime="true" :full="true" class="_panel"/>
+			</MkDateSeparatedList>
+		</template>
+	</MkPagination>
+</MkPullToRefresh>
 </template>

 <script lang="ts" setup>
-import { onUnmounted, onMounted, computed, shallowRef } from 'vue';
+import { onUnmounted, onDeactivated, onMounted, computed, shallowRef, onActivated } from 'vue';
 import MkPagination, { Paging } from '@/components/MkPagination.vue';
 import XNotification from '@/components/MkNotification.vue';
 import MkDateSeparatedList from '@/components/MkDateSeparatedList.vue';
@@ -32,6 +34,8 @@ import { $i } from '@/account.js';
 import { i18n } from '@/i18n.js';
 import { notificationTypes } from '@/const.js';
 import { infoImageUrl } from '@/instance.js';
+import { defaultStore } from '@/store.js';
+import MkPullToRefresh from '@/components/MkPullToRefresh.vue';

 const props = defineProps<{
 	excludeTypes?: typeof notificationTypes[number][];
@@ -39,7 +43,13 @@ const props = defineProps<{

 const pagingComponent = shallowRef<InstanceType<typeof MkPagination>>();

-const pagination: Paging = {
+const pagination: Paging = defaultStore.state.useGroupedNotifications ? {
+	endpoint: 'i/notifications-grouped' as const,
+	limit: 20,
+	params: computed(() => ({
+		excludeTypes: props.excludeTypes ?? undefined,
+	})),
+} : {
 	endpoint: 'i/notifications' as const,
 	limit: 20,
 	params: computed(() => ({
@@ -47,7 +57,7 @@ const pagination: Paging = {
 	})),
 };

-const onNotification = (notification) => {
+function onNotification(notification) {
 	const isMuted = props.excludeTypes ? props.excludeTypes.includes(notification.type) : false;
 	if (isMuted || document.visibilityState === 'visible') {
 		useStream().send('readNotification');
@@ -56,7 +66,15 @@ const onNotification = (notification) => {
 	if (!isMuted) {
 		pagingComponent.value.prepend(notification);
 	}
-};
+}
+
+function reload() {
+	return new Promise<void>((res) => {
+		pagingComponent.value?.reload().then(() => {
+			res();
+		});
+	});
+}

 let connection;

@@ -65,9 +83,19 @@ onMounted(() => {
 	connection.on('notification', onNotification);
 });

+onActivated(() => {
+	pagingComponent.value?.reload();
+	connection = useStream().useChannel('main');
+	connection.on('notification', onNotification);
+});
+
 onUnmounted(() => {
 	if (connection) connection.dispose();
 });
+
+onDeactivated(() => {
+	if (connection) connection.dispose();
+});
 </script>

 <style lang="scss" module>
--- a/packages/frontend/src/components/MkPageWindow.vue
+++ b/packages/frontend/src/components/MkPageWindow.vue
@@ -166,6 +166,8 @@ defineExpose({

 <style lang="scss" module>
 .root {
+	overscroll-behavior: contain;
+
 	min-height: 100%;
 	background: var(--bg);

--- a/packages/frontend/src/components/MkPagination.vue
+++ b/packages/frontend/src/components/MkPagination.vue
@@ -90,6 +90,7 @@ const props = withDefaults(defineProps<{

 const emit = defineEmits<{
 	(ev: 'queue', count: number): void;
+	(ev: 'status', error: boolean): void;
 }>();

 let rootEl = $shallowRef<HTMLElement>();
@@ -164,6 +165,11 @@ watch(queue, (a, b) => {
 	emit('queue', queue.value.length);
 }, { deep: true });

+watch(error, (n, o) => {
+	if (n === o) return;
+	emit('status', n);
+});
+
 async function init(): Promise<void> {
 	queue.value = [];
 	fetching.value = true;
--- a/packages/frontend/src/components/MkPostForm.vue
+++ b/packages/frontend/src/components/MkPostForm.vue
@@ -74,7 +74,7 @@ SPDX-License-Identifier: AGPL-3.0-only
 	<MkInfo v-if="files.length > 0" warn :class="$style.guidelineInfo" :rounded="false"><Mfm :text="i18n.t('_postForm.guidelineInfo', { tosUrl: instance.tosUrl, nsfwGuideUrl })"/></MkInfo>
 	<XPostFormAttaches v-model="files" @detach="detachFile" @changeSensitive="updateFileSensitive" @changeName="updateFileName" @replaceFile="replaceFile"/>
 	<MkPollEditor v-if="poll" v-model="poll" @destroyed="poll = null"/>
-	<MkNotePreview v-if="showPreview" :class="$style.preview" :text="text"/>
+	<MkNotePreview v-if="showPreview" :class="$style.preview" :text="text" :user="postAccount ?? $i"/>
 	<div v-if="showingOptions" style="padding: 8px 16px;">
 	</div>
 	<footer :class="$style.footer">
@@ -99,7 +99,7 @@ SPDX-License-Identifier: AGPL-3.0-only
 </template>

 <script lang="ts" setup>
-import { inject, watch, nextTick, onMounted, defineAsyncComponent } from 'vue';
+import { inject, watch, nextTick, onMounted, defineAsyncComponent, provide } from 'vue';
 import * as mfm from 'mfm-js';
 import * as Misskey from 'misskey-js';
 import insertTextAtCursor from 'insert-text-at-cursor';
@@ -144,15 +144,22 @@ const props = withDefaults(defineProps<{
 	fixed?: boolean;
 	autofocus?: boolean;
 	freezeAfterPosted?: boolean;
+	mock?: boolean;
 }>(), {
 	initialVisibleUsers: () => [],
 	autofocus: true,
+	mock: false,
 });

+provide('mock', props.mock);
+
 const emit = defineEmits<{
 	(ev: 'posted'): void;
 	(ev: 'cancel'): void;
 	(ev: 'esc'): void;
+
+	// Mock用
+	(ev: 'fileChangeSensitive', fileId: string, to: boolean): void;
 }>();

 const textareaEl = $shallowRef<HTMLTextAreaElement | null>(null);
@@ -242,7 +249,7 @@ const maxTextLength = $computed((): number => {
 });

 const canPost = $computed((): boolean => {
-	return !posting && !posted &&
+	return !props.mock && !posting && !posted &&
 		(1 <= textLength || 1 <= files.length || !!poll || !!props.renote) &&
 		(textLength <= maxTextLength) &&
 		(!poll || poll.choices.length >= 2);
@@ -295,6 +302,10 @@ if (props.reply && props.reply.text != null) {
 	}
 }

+if ($i?.isSilenced && visibility === 'public') {
+	visibility = 'home';
+}
+
 if (props.channel) {
 	visibility = 'public';
 	localOnly = true; // TODO: チャンネルが連合するようになった折には消す
@@ -399,6 +410,8 @@ function focus() {
 }

 function chooseFileFrom(ev) {
+	if (props.mock) return;
+
 	selectFiles(ev.currentTarget ?? ev.target, i18n.ts.attachFile).then(files_ => {
 		for (const file of files_) {
 			files.push(file);
@@ -411,6 +424,9 @@ function detachFile(id) {
 }

 function updateFileSensitive(file, sensitive) {
+	if (props.mock) {
+		emit('fileChangeSensitive', file.id, sensitive);
+	}
 	files[files.findIndex(x => x.id === file.id)].isSensitive = sensitive;
 }

@@ -423,6 +439,8 @@ function replaceFile(file: Misskey.entities.DriveFile, newFile: Misskey.entities
 }

 function upload(file: File, name?: string): void {
+	if (props.mock) return;
+
 	uploadFile(file, defaultStore.state.uploadFolder, name).then(res => {
 		files.push(res);
 	});
@@ -437,6 +455,7 @@ function setVisibility() {

 	os.popup(defineAsyncComponent(() => import('@/components/MkVisibilityPicker.vue')), {
 		currentVisibility: visibility,
+		isSilenced: $i?.isSilenced,
 		localOnly: localOnly,
 		src: visibilityButton,
 	}, {
@@ -548,6 +567,8 @@ function onCompositionEnd(ev: CompositionEvent) {
 }

 async function onPaste(ev: ClipboardEvent) {
+	if (props.mock) return;
+
 	for (const { item, i } of Array.from(ev.clipboardData.items, (item, i) => ({ item, i }))) {
 		if (item.kind === 'file') {
 			const file = item.getAsFile();
@@ -632,7 +653,7 @@ function onDrop(ev): void {
 }

 function saveDraft() {
-	if (props.instant) return;
+	if (props.instant || props.mock) return;

 	const draftData = JSON.parse(miLocalStorage.getItem('drafts') ?? '{}');

@@ -661,6 +682,14 @@ function deleteDraft() {
 }

 async function post(ev?: MouseEvent) {
+	if (useCw && (cw == null || cw.trim() === '')) {
+		os.alert({
+			type: 'error',
+			text: i18n.ts.cwNotationRequired,
+		});
+		return;
+	}
+
 	if (ev) {
 		const el = ev.currentTarget ?? ev.target;
 		const rect = el.getBoundingClientRect();
@@ -669,6 +698,8 @@ async function post(ev?: MouseEvent) {
 		os.popup(MkRippleEffect, { x, y }, {}, 'end');
 	}

+	if (props.mock) return;
+
 	const annoying =
 		text.includes('$[x2') ||
 		text.includes('$[x3') ||
@@ -834,6 +865,8 @@ function showActions(ev) {
 let postAccount = $ref<Misskey.entities.UserDetailed | null>(null);

 function openAccountMenu(ev: MouseEvent) {
+	if (props.mock) return;
+
 	openAccountMenu_({
 		withExtraOperation: false,
 		includeCurrentAccount: true,
@@ -864,7 +897,7 @@ onMounted(() => {

 	nextTick(() => {
 		// 書きかけの投稿を復元
-		if (!props.instant && !props.mention && !props.specified) {
+		if (!props.instant && !props.mention && !props.specified && !props.mock) {
 			const draft = JSON.parse(miLocalStorage.getItem('drafts') ?? '{}')[draftKey];
 			if (draft) {
 				text = draft.data.text;
--- a/packages/frontend/src/components/MkPostFormAttaches.vue
+++ b/packages/frontend/src/components/MkPostFormAttaches.vue
@@ -20,7 +20,7 @@ SPDX-License-Identifier: AGPL-3.0-only
 </template>

 <script lang="ts" setup>
-import { defineAsyncComponent } from 'vue';
+import { defineAsyncComponent, inject } from 'vue';
 import * as Misskey from 'misskey-js';
 import MkDriveFileThumbnail from '@/components/MkDriveFileThumbnail.vue';
 import * as os from '@/os.js';
@@ -33,6 +33,8 @@ const props = defineProps<{
 	detachMediaFn?: (id: string) => void;
 }>();

+const mock = inject<boolean>('mock', false);
+
 const emit = defineEmits<{
 	(ev: 'update:modelValue', value: any[]): void;
 	(ev: 'detach', id: string): void;
@@ -44,6 +46,8 @@ const emit = defineEmits<{
 let menuShowing = false;

 function detachMedia(id: string) {
+	if (mock) return;
+
 	if (props.detachMediaFn) {
 		props.detachMediaFn(id);
 	} else {
@@ -52,6 +56,11 @@ function detachMedia(id: string) {
 }

 function toggleSensitive(file) {
+	if (mock) {
+		emit('changeSensitive', file, !file.isSensitive);
+		return;
+	}
+
 	os.api('drive/files/update', {
 		fileId: file.id,
 		isSensitive: !file.isSensitive,
@@ -59,7 +68,10 @@ function toggleSensitive(file) {
 		emit('changeSensitive', file, !file.isSensitive);
 	});
 }
+
 async function rename(file) {
+	if (mock) return;
+
 	const { canceled, result } = await os.inputText({
 		title: i18n.ts.enterFileName,
 		default: file.name,
@@ -76,6 +88,8 @@ async function rename(file) {
 }

 async function describe(file) {
+	if (mock) return;
+
 	os.popup(defineAsyncComponent(() => import('@/components/MkFileCaptionEditWindow.vue')), {
 		default: file.comment !== null ? file.comment : '',
 		file: file,
@@ -93,6 +107,8 @@ async function describe(file) {
 }

 async function crop(file: Misskey.entities.DriveFile): Promise<void> {
+	if (mock) return;
+
 	const newFile = await os.cropImage(file, { aspectRatio: NaN });
 	emit('replaceFile', file, newFile);
 }
--- a/packages/frontend/src/components/MkPullToRefresh.vue
+++ b/packages/frontend/src/components/MkPullToRefresh.vue
@@ -0,0 +1,264 @@
+<!--
+SPDX-FileCopyrightText: syuilo and other misskey contributors
+SPDX-License-Identifier: AGPL-3.0-only
+-->
+
+<template>
+<div ref="rootEl">
+	<div v-if="isPullStart" :class="$style.frame" :style="`--frame-min-height: ${pullDistance / (PULL_BRAKE_BASE + (pullDistance / PULL_BRAKE_FACTOR))}px;`">
+		<div :class="$style.frameContent">
+			<MkLoading v-if="isRefreshing" :class="$style.loader" :em="true"/>
+			<i v-else class="ti ti-arrow-bar-to-down" :class="[$style.icon, { [$style.refresh]: isPullEnd }]"></i>
+			<div :class="$style.text">
+				<template v-if="isPullEnd">{{ i18n.ts.releaseToRefresh }}</template>
+				<template v-else-if="isRefreshing">{{ i18n.ts.refreshing }}</template>
+				<template v-else>{{ i18n.ts.pullDownToRefresh }}</template>
+			</div>
+		</div>
+	</div>
+	<div :class="{ [$style.slotClip]: isPullStart }">
+		<slot/>
+	</div>
+</div>
+</template>
+
+<script lang="ts" setup>
+import { onMounted, onUnmounted, watch } from 'vue';
+import { deviceKind } from '@/scripts/device-kind.js';
+import { i18n } from '@/i18n.js';
+import { getScrollContainer } from '@/scripts/scroll.js';
+
+const SCROLL_STOP = 10;
+const MAX_PULL_DISTANCE = Infinity;
+const FIRE_THRESHOLD = 230;
+const RELEASE_TRANSITION_DURATION = 200;
+const PULL_BRAKE_BASE = 1.5;
+const PULL_BRAKE_FACTOR = 170;
+
+let isPullStart = $ref(false);
+let isPullEnd = $ref(false);
+let isRefreshing = $ref(false);
+let pullDistance = $ref(0);
+
+let supportPointerDesktop = false;
+let startScreenY: number | null = null;
+
+const rootEl = $shallowRef<HTMLDivElement>();
+let scrollEl: HTMLElement | null = null;
+
+let disabled = false;
+
+const props = withDefaults(defineProps<{
+	refresher: () => Promise<void>;
+}>(), {
+	refresher: () => Promise.resolve(),
+});
+
+const emit = defineEmits<{
+	(ev: 'refresh'): void;
+}>();
+
+function getScreenY(event) {
+	if (supportPointerDesktop) {
+		return event.screenY;
+	}
+	return event.touches[0].screenY;
+}
+
+function moveStart(event) {
+	if (!isPullStart && !isRefreshing && !disabled) {
+		isPullStart = true;
+		startScreenY = getScreenY(event);
+		pullDistance = 0;
+	}
+}
+
+function moveBySystem(to: number): Promise<void> {
+	return new Promise(r => {
+		const startHeight = pullDistance;
+		const overHeight = pullDistance - to;
+		if (overHeight < 1) {
+			r();
+			return;
+		}
+		const startTime = Date.now();
+		let intervalId = setInterval(() => {
+			const time = Date.now() - startTime;
+			if (time > RELEASE_TRANSITION_DURATION) {
+				pullDistance = to;
+				clearInterval(intervalId);
+				r();
+				return;
+			}
+			const nextHeight = startHeight - (overHeight / RELEASE_TRANSITION_DURATION) * time;
+			if (pullDistance < nextHeight) return;
+			pullDistance = nextHeight;
+		}, 1);
+	});
+}
+
+async function fixOverContent() {
+	if (pullDistance > FIRE_THRESHOLD) {
+		await moveBySystem(FIRE_THRESHOLD);
+	}
+}
+
+async function closeContent() {
+	if (pullDistance > 0) {
+		await moveBySystem(0);
+	}
+}
+
+function moveEnd() {
+	if (isPullStart && !isRefreshing) {
+		startScreenY = null;
+		if (isPullEnd) {
+			isPullEnd = false;
+			isRefreshing = true;
+			fixOverContent().then(() => {
+				emit('refresh');
+				props.refresher().then(() => {
+					refreshFinished();
+				});
+			});
+		} else {
+			closeContent().then(() => isPullStart = false);
+		}
+	}
+}
+
+function moving(event: TouchEvent | PointerEvent) {
+	if (!isPullStart || isRefreshing || disabled) return;
+
+	if ((scrollEl?.scrollTop ?? 0) > (supportPointerDesktop ? SCROLL_STOP : SCROLL_STOP + pullDistance)) {
+		pullDistance = 0;
+		isPullEnd = false;
+		moveEnd();
+		return;
+	}
+
+	if (startScreenY === null) {
+		startScreenY = getScreenY(event);
+	}
+	const moveScreenY = getScreenY(event);
+
+	const moveHeight = moveScreenY - startScreenY!;
+	pullDistance = Math.min(Math.max(moveHeight, 0), MAX_PULL_DISTANCE);
+
+	if (pullDistance > 0) {
+		if (event.cancelable) event.preventDefault();
+	}
+
+	isPullEnd = pullDistance >= FIRE_THRESHOLD;
+}
+
+/**
+ * emit(refresh)が完了したことを知らせる関数
+ *
+ * タイムアウトがないのでこれを最終的に実行しないと出たままになる
+ */
+function refreshFinished() {
+	closeContent().then(() => {
+		isPullStart = false;
+		isRefreshing = false;
+	});
+}
+
+function setDisabled(value) {
+	disabled = value;
+}
+
+function onScrollContainerScroll() {
+	const scrollPos = scrollEl!.scrollTop;
+
+	// When at the top of the page, disable vertical overscroll so passive touch listeners can take over.
+	if (scrollPos === 0) {
+		scrollEl!.style.touchAction = 'pan-x pan-down pinch-zoom';
+		registerEventListenersForReadyToPull();
+	} else {
+		scrollEl!.style.touchAction = 'auto';
+		unregisterEventListenersForReadyToPull();
+	}
+}
+
+function registerEventListenersForReadyToPull() {
+	if (rootEl == null) return;
+	rootEl.addEventListener('touchstart', moveStart, { passive: true });
+	rootEl.addEventListener('touchmove', moving, { passive: false }); // passive: falseにしないとpreventDefaultが使えない
+}
+
+function unregisterEventListenersForReadyToPull() {
+	if (rootEl == null) return;
+	rootEl.removeEventListener('touchstart', moveStart);
+	rootEl.removeEventListener('touchmove', moving);
+}
+
+onMounted(() => {
+	if (rootEl == null) return;
+
+	scrollEl = getScrollContainer(rootEl);
+	if (scrollEl == null) return;
+
+	scrollEl.addEventListener('scroll', onScrollContainerScroll, { passive: true });
+
+	rootEl.addEventListener('touchend', moveEnd, { passive: true });
+
+	registerEventListenersForReadyToPull();
+});
+
+onUnmounted(() => {
+	if (scrollEl) scrollEl.removeEventListener('scroll', onScrollContainerScroll);
+
+	unregisterEventListenersForReadyToPull();
+});
+
+defineExpose({
+	setDisabled,
+});
+</script>
+
+<style lang="scss" module>
+.frame {
+	position: relative;
+	overflow: clip;
+
+	width: 100%;
+	min-height: var(--frame-min-height, 0px);
+
+	mask-image: linear-gradient(90deg, #000 0%, #000 80%, transparent);
+	-webkit-mask-image: -webkit-linear-gradient(90deg, #000 0%, #000 80%, transparent);
+
+	pointer-events: none;
+}
+
+.frameContent {
+	position: absolute;
+	bottom: 0;
+	width: 100%;
+	margin: 5px 0;
+	display: flex;
+	flex-direction: column;
+	align-items: center;
+	font-size: 14px;
+
+	> .icon, > .loader {
+		margin: 6px 0;
+	}
+
+	> .icon {
+		transition: transform .25s;
+
+		&.refresh {
+			transform: rotate(180deg);
+		}
+	}
+
+	> .text {
+		margin: 5px 0;
+	}
+}
+
+.slotClip {
+	overflow-y: clip;
+}
+</style>
--- a/packages/frontend/src/components/MkRange.vue
+++ b/packages/frontend/src/components/MkRange.vue
@@ -34,6 +34,7 @@ const props = withDefaults(defineProps<{
 	textConverter?: (value: number) => string,
 	showTicks?: boolean;
 	easing?: boolean;
+	continuousUpdate?: boolean;
 }>(), {
 	step: 1,
 	textConverter: (v) => v.toString(),
@@ -123,6 +124,10 @@ const onMousedown = (ev: MouseEvent | TouchEvent) => {
 		const pointerX = ev.touches && ev.touches.length > 0 ? ev.touches[0].clientX : ev.clientX;
 		const pointerPositionOnContainer = pointerX - (containerRect.left + (thumbWidth / 2));
 		rawValue.value = Math.min(1, Math.max(0, pointerPositionOnContainer / (containerEl.value!.offsetWidth - thumbWidth)));
+
+		if (props.continuousUpdate) {
+			emit('update:modelValue', finalValue.value);
+		}
 	};

 	let beforeValue = finalValue.value;
--- a/packages/frontend/src/components/MkReactionIcon.vue
+++ b/packages/frontend/src/components/MkReactionIcon.vue
@@ -4,16 +4,31 @@ SPDX-License-Identifier: AGPL-3.0-only
 -->

 <template>
-<MkCustomEmoji v-if="reaction[0] === ':'" :name="reaction" :normal="true" :noStyle="noStyle" :url="emojiUrl"/>
-<MkEmoji v-else :emoji="reaction" :normal="true" :noStyle="noStyle"/>
+<MkCustomEmoji v-if="reaction[0] === ':'" ref="elRef" :name="reaction" :normal="true" :noStyle="noStyle" :url="emojiUrl"/>
+<MkEmoji v-else ref="elRef" :emoji="reaction" :normal="true" :noStyle="noStyle"/>
 </template>

 <script lang="ts" setup>
-import { } from 'vue';
+import { defineAsyncComponent, shallowRef } from 'vue';
+import { useTooltip } from '@/scripts/use-tooltip.js';
+import * as os from '@/os.js';

 const props = defineProps<{
 	reaction: string;
 	noStyle?: boolean;
 	emojiUrl?: string;
+	withTooltip?: boolean;
 }>();
+
+const elRef = shallowRef();
+
+if (props.withTooltip) {
+	useTooltip(elRef, (showing) => {
+		os.popup(defineAsyncComponent(() => import('@/components/MkReactionTooltip.vue')), {
+			showing,
+			reaction: props.reaction.replace(/^:(\w+):$/, ':$1@.:'),
+			targetElement: elRef.value.$el,
+		}, {}, 'closed');
+	});
+}
 </script>
--- a/packages/frontend/src/components/MkReactionsViewer.details.vue
+++ b/packages/frontend/src/components/MkReactionsViewer.details.vue
@@ -15,7 +15,7 @@ SPDX-License-Identifier: AGPL-3.0-only
 				<MkAvatar :class="$style.avatar" :user="u"/>
 				<MkUserName :user="u" :nowrap="true"/>
 			</div>
-			<div v-if="users.length > 10" :class="$style.more">+{{ count - 10 }}</div>
+			<div v-if="count > 10" :class="$style.more">+{{ count - 10 }}</div>
 		</div>
 	</div>
 </MkTooltip>
--- a/packages/frontend/src/components/MkReactionsViewer.reaction.vue
+++ b/packages/frontend/src/components/MkReactionsViewer.reaction.vue
@@ -17,7 +17,7 @@ SPDX-License-Identifier: AGPL-3.0-only
 </template>

 <script lang="ts" setup>
-import { computed, onMounted, shallowRef, watch } from 'vue';
+import { computed, inject, onMounted, shallowRef, watch } from 'vue';
 import * as Misskey from 'misskey-js';
 import XDetails from '@/components/MkReactionsViewer.details.vue';
 import MkReactionIcon from '@/components/MkReactionIcon.vue';
@@ -36,6 +36,12 @@ const props = defineProps<{
 	note: Misskey.entities.Note;
 }>();

+const mock = inject<boolean>('mock', false);
+
+const emit = defineEmits<{
+	(ev: 'reactionToggled', emoji: string, newCount: number): void;
+}>();
+
 const buttonEl = shallowRef<HTMLElement>();

 const canToggle = computed(() => !props.reaction.match(/@\w/) && $i);
@@ -53,6 +59,11 @@ async function toggleReaction() {
 		});
 		if (confirm.canceled) return;

+		if (mock) {
+			emit('reactionToggled', props.reaction, (props.count - 1));
+			return;
+		}
+
 		os.api('notes/reactions/delete', {
 			noteId: props.note.id,
 		}).then(() => {
@@ -64,6 +75,11 @@ async function toggleReaction() {
 			}
 		});
 	} else {
+		if (mock) {
+			emit('reactionToggled', props.reaction, (props.count + 1));
+			return;
+		}
+
 		os.api('notes/reactions/create', {
 			noteId: props.note.id,
 			reaction: props.reaction,
@@ -92,24 +108,26 @@ onMounted(() => {
 	if (!props.isInitial) anime();
 });

-useTooltip(buttonEl, async (showing) => {
-	const reactions = await os.apiGet('notes/reactions', {
-		noteId: props.note.id,
-		type: props.reaction,
-		limit: 11,
-		_cacheKey_: props.count,
-	});
+if (!mock) {
+	useTooltip(buttonEl, async (showing) => {
+		const reactions = await os.apiGet('notes/reactions', {
+			noteId: props.note.id,
+			type: props.reaction,
+			limit: 10,
+			_cacheKey_: props.count,
+		});

-	const users = reactions.map(x => x.user);
+		const users = reactions.map(x => x.user);

-	os.popup(XDetails, {
-		showing,
-		reaction: props.reaction,
-		users,
-		count: props.count,
-		targetElement: buttonEl.value,
-	}, {}, 'closed');
-}, 100);
+		os.popup(XDetails, {
+			showing,
+			reaction: props.reaction,
+			users,
+			count: props.count,
+			targetElement: buttonEl.value,
+		}, {}, 'closed');
+	}, 100);
+}
 </script>

 <style lang="scss" module>
--- a/packages/frontend/src/components/MkReactionsViewer.vue
+++ b/packages/frontend/src/components/MkReactionsViewer.vue
@@ -12,14 +12,14 @@ SPDX-License-Identifier: AGPL-3.0-only
 	:moveClass="defaultStore.state.animation ? $style.transition_x_move : ''"
 	tag="div" :class="$style.root"
 >
-	<XReaction v-for="[reaction, count] in reactions" :key="reaction" :reaction="reaction" :count="count" :isInitial="initialReactions.has(reaction)" :note="note"/>
+	<XReaction v-for="[reaction, count] in reactions" :key="reaction" :reaction="reaction" :count="count" :isInitial="initialReactions.has(reaction)" :note="note" @reactionToggled="onMockToggleReaction"/>
 	<slot v-if="hasMoreReactions" name="more"/>
 </TransitionGroup>
 </template>

 <script lang="ts" setup>
 import * as Misskey from 'misskey-js';
-import { watch } from 'vue';
+import { inject, watch } from 'vue';
 import XReaction from '@/components/MkReactionsViewer.reaction.vue';
 import { defaultStore } from '@/store.js';

@@ -30,6 +30,12 @@ const props = withDefaults(defineProps<{
 	maxNumber: Infinity,
 });

+const mock = inject<boolean>('mock', false);
+
+const emit = defineEmits<{
+	(ev: 'mockUpdateMyReaction', emoji: string, delta: number): void;
+}>();
+
 const initialReactions = new Set(Object.keys(props.note.reactions));

 let reactions = $ref<[string, number][]>([]);
@@ -39,6 +45,15 @@ if (props.note.myReaction && !Object.keys(reactions).includes(props.note.myReact
 	reactions[props.note.myReaction] = props.note.reactions[props.note.myReaction];
 }

+function onMockToggleReaction(emoji: string, count: number) {
+	if (!mock) return;
+
+	const i = reactions.findIndex((item) => item[0] === emoji);
+	if (i < 0) return;
+
+	emit('mockUpdateMyReaction', emoji, (count - reactions[i][1]));
+}
+
 watch([() => props.note.reactions, () => props.maxNumber], ([newSource, maxNumber]) => {
 	let newReactions: [string, number][] = [];
 	hasMoreReactions = Object.keys(newSource).length > maxNumber;
--- a/packages/frontend/src/components/MkSubNoteContent.vue
+++ b/packages/frontend/src/components/MkSubNoteContent.vue
@@ -9,7 +9,7 @@ SPDX-License-Identifier: AGPL-3.0-only
 		<span v-if="note.isHidden" style="opacity: 0.5">({{ i18n.ts.private }})</span>
 		<span v-if="note.deletedAt" style="opacity: 0.5">({{ i18n.ts.deleted }})</span>
 		<MkA v-if="note.replyId" :class="$style.reply" :to="`/notes/${note.replyId}`"><i class="ti ti-arrow-back-up"></i></MkA>
-		<Mfm v-if="note.text" :text="note.text" :author="note.user" :i="$i" :emojiUrls="note.emojis"/>
+		<Mfm v-if="note.text" :text="note.text" :author="note.user" :emojiUrls="note.emojis"/>
 		<MkA v-if="note.renoteId" :class="$style.rp" :to="`/notes/${note.renoteId}`">RN: ...</MkA>
 	</div>
 	<details v-if="note.files.length > 0">
@@ -42,7 +42,7 @@ const props = defineProps<{
 	note: Misskey.entities.Note;
 }>();

-const isLong = shouldCollapsed(props.note);
+const isLong = shouldCollapsed(props.note, []);

 const collapsed = $ref(isLong);
 </script>
--- a/packages/frontend/src/components/MkTimeline.vue
+++ b/packages/frontend/src/components/MkTimeline.vue
@@ -4,13 +4,16 @@ SPDX-License-Identifier: AGPL-3.0-only
 -->

 <template>
-<MkNotes ref="tlComponent" :noGap="!defaultStore.state.showGapBetweenNotesInTimeline" :pagination="pagination" @queue="emit('queue', $event)"/>
+<MkPullToRefresh ref="prComponent" :refresher="() => reloadTimeline()">
+	<MkNotes ref="tlComponent" :noGap="!defaultStore.state.showGapBetweenNotesInTimeline" :pagination="pagination" @queue="emit('queue', $event)" @status="prComponent.setDisabled($event)"/>
+</MkPullToRefresh>
 </template>

 <script lang="ts" setup>
 import { computed, provide, onUnmounted } from 'vue';
 import MkNotes from '@/components/MkNotes.vue';
-import { useStream } from '@/stream.js';
+import MkPullToRefresh from '@/components/MkPullToRefresh.vue';
+import { useStream, reloadStream } from '@/stream.js';
 import * as sound from '@/scripts/sound.js';
 import { $i } from '@/account.js';
 import { instance } from '@/instance.js';
@@ -39,6 +42,7 @@ const emit = defineEmits<{

 provide('inChannel', computed(() => props.src === 'channel'));

+const prComponent: InstanceType<typeof MkPullToRefresh> = $ref();
 const tlComponent: InstanceType<typeof MkNotes> = $ref();

 let tlNotesCount = 0;
@@ -65,29 +69,79 @@ let connection;
 let connection2;

 const stream = useStream();
+const connectChannel = () => {
+	if (props.src === 'antenna') {
+		connection = stream.useChannel('antenna', {
+			antennaId: props.antenna,
+		});
+	} else if (props.src === 'home') {
+		connection = stream.useChannel('homeTimeline', {
+			withRenotes: props.withRenotes,
+			withFiles: props.onlyFiles ? true : undefined,
+		});
+		connection2 = stream.useChannel('main');
+	} else if (props.src === 'local') {
+		connection = stream.useChannel('localTimeline', {
+			withRenotes: props.withRenotes,
+			withReplies: props.withReplies,
+			withFiles: props.onlyFiles ? true : undefined,
+		});
+	} else if (props.src === 'media') {
+		connection = stream.useChannel('hybridTimeline', {
+			withRenotes: props.withRenotes,
+			withReplies: props.withReplies,
+			withFiles: true,
+		});
+	} else if (props.src === 'social') {
+		connection = stream.useChannel('hybridTimeline', {
+			withRenotes: props.withRenotes,
+			withReplies: props.withReplies,
+			withFiles: props.onlyFiles ? true : undefined,
+		});
+	} else if (props.src === 'global') {
+		connection = stream.useChannel('globalTimeline', {
+			withRenotes: props.withRenotes,
+			withFiles: props.onlyFiles ? true : undefined,
+		});
+	} else if (props.src === 'mentions') {
+		connection = stream.useChannel('main');
+		connection.on('mention', prepend);
+	} else if (props.src === 'directs') {
+		const onNote = note => {
+			if (note.visibility === 'specified') {
+				prepend(note);
+			}
+		};
+		connection = stream.useChannel('main');
+		connection.on('mention', onNote);
+	} else if (props.src === 'list') {
+		connection = stream.useChannel('userList', {
+			withFiles: props.onlyFiles ? true : undefined,
+			listId: props.list,
+		});
+	} else if (props.src === 'channel') {
+		connection = stream.useChannel('channel', {
+			channelId: props.channel,
+		});
+	} else if (props.src === 'role') {
+		connection = stream.useChannel('roleTimeline', {
+			roleId: props.role,
+		});
+	}
+	if (props.src !== 'directs' || props.src !== 'mentions') connection.on('note', prepend);
+};

 if (props.src === 'antenna') {
 	endpoint = 'antennas/notes';
 	query = {
 		antennaId: props.antenna,
 	};
-	connection = stream.useChannel('antenna', {
-		antennaId: props.antenna,
-	});
-	connection.on('note', prepend);
 } else if (props.src === 'home') {
 	endpoint = 'notes/timeline';
 	query = {
 		withRenotes: props.withRenotes,
 		withFiles: props.onlyFiles ? true : undefined,
 	};
-	connection = stream.useChannel('homeTimeline', {
-		withRenotes: props.withRenotes,
-		withFiles: props.onlyFiles ? true : undefined,
-	});
-	connection.on('note', prepend);
-
-	connection2 = stream.useChannel('main');
 } else if (props.src === 'local') {
 	endpoint = 'notes/local-timeline';
 	query = {
@@ -95,23 +149,13 @@ if (props.src === 'antenna') {
 		withReplies: props.withReplies,
 		withFiles: props.onlyFiles ? true : undefined,
 	};
-	connection = stream.useChannel('localTimeline', {
-		withRenotes: props.withRenotes,
-		withReplies: props.withReplies,
-		withFiles: props.onlyFiles ? true : undefined,
-	});
-	connection.on('note', prepend);
 } else if (props.src === 'media') {
 	endpoint = 'notes/hybrid-timeline';
 	query = {
+		withRenotes: props.withRenotes,
+		withReplies: props.withReplies,
 		withFiles: true,
-		withReplies: defaultStore.state.showTimelineReplies,
 	};
-	connection = stream.useChannel('hybridTimeline', {
-		withFiles: true,
-		withReplies: defaultStore.state.showTimelineReplies,
-	});
-	connection.on('note', prepend);
 } else if (props.src === 'social') {
 	endpoint = 'notes/hybrid-timeline';
 	query = {
@@ -119,68 +163,44 @@ if (props.src === 'antenna') {
 		withReplies: props.withReplies,
 		withFiles: props.onlyFiles ? true : undefined,
 	};
-	connection = stream.useChannel('hybridTimeline', {
-		withRenotes: props.withRenotes,
-		withReplies: props.withReplies,
-		withFiles: props.onlyFiles ? true : undefined,
-	});
-	connection.on('note', prepend);
 } else if (props.src === 'global') {
 	endpoint = 'notes/global-timeline';
 	query = {
 		withRenotes: props.withRenotes,
 		withFiles: props.onlyFiles ? true : undefined,
 	};
-	connection = stream.useChannel('globalTimeline', {
-		withRenotes: props.withRenotes,
-		withFiles: props.onlyFiles ? true : undefined,
-	});
-	connection.on('note', prepend);
 } else if (props.src === 'mentions') {
 	endpoint = 'notes/mentions';
-	connection = stream.useChannel('main');
-	connection.on('mention', prepend);
 } else if (props.src === 'directs') {
 	endpoint = 'notes/mentions';
 	query = {
 		visibility: 'specified',
 	};
-	const onNote = note => {
-		if (note.visibility === 'specified') {
-			prepend(note);
-		}
-	};
-	connection = stream.useChannel('main');
-	connection.on('mention', onNote);
 } else if (props.src === 'list') {
 	endpoint = 'notes/user-list-timeline';
 	query = {
 		withFiles: props.onlyFiles ? true : undefined,
 		listId: props.list,
 	};
-	connection = stream.useChannel('userList', {
-		withFiles: props.onlyFiles ? true : undefined,
-		listId: props.list,
-	});
-	connection.on('note', prepend);
 } else if (props.src === 'channel') {
 	endpoint = 'channels/timeline';
 	query = {
 		channelId: props.channel,
 	};
-	connection = stream.useChannel('channel', {
-		channelId: props.channel,
-	});
-	connection.on('note', prepend);
 } else if (props.src === 'role') {
 	endpoint = 'roles/notes';
 	query = {
 		roleId: props.role,
 	};
-	connection = stream.useChannel('roleTimeline', {
-		roleId: props.role,
+}
+
+if (!defaultStore.state.disableStreamingTimeline) {
+	connectChannel();
+
+	onUnmounted(() => {
+		connection.dispose();
+		if (connection2) connection2.dispose();
 	});
-	connection.on('note', prepend);
 }

 const pagination = {
@@ -189,15 +209,18 @@ const pagination = {
 	params: query,
 };

-onUnmounted(() => {
-	connection.dispose();
-	if (connection2) connection2.dispose();
-});
+function reloadTimeline() {
+	return new Promise<void>((res) => {
+		tlNotesCount = 0;

-/* TODO
-const timetravel = (date?: Date) => {
-	this.date = date;
-	this.$refs.tl.reload();
-};
-*/
+		tlComponent.pagingComponent?.reload().then(() => {
+			reloadStream();
+			res();
+		});
+	});
+}
+
+defineExpose({
+	reloadTimeline,
+});
 </script>
--- a/packages/frontend/src/components/MkTutorialDialog.Note.vue
+++ b/packages/frontend/src/components/MkTutorialDialog.Note.vue
@@ -0,0 +1,117 @@
+<!--
+SPDX-FileCopyrightText: syuilo and other misskey contributors
+SPDX-License-Identifier: AGPL-3.0-only
+-->
+
+<template>
+<div v-if="phase === 'aboutNote'" class="_gaps">
+	<div style="text-align: center; padding: 0 16px;">{{ i18n.ts._initialTutorial._note.description }}</div>
+	<MkNote :class="$style.exampleNoteRoot" style="pointer-events: none;" :note="exampleNote" :mock="true"/>
+	<div class="_gaps_s">
+		<div><i class="ti ti-arrow-back-up"></i> <b>{{ i18n.ts.reply }}</b> … {{ i18n.ts._initialTutorial._note.reply }}</div>
+		<div><i class="ti ti-repeat"></i> <b>{{ i18n.ts.renote }}</b> … {{ i18n.ts._initialTutorial._note.renote }}</div>
+		<div><i class="ti ti-plus"></i> <b>{{ i18n.ts.reaction }}</b> … {{ i18n.ts._initialTutorial._note.reaction }}</div>
+		<div><i class="ti ti-dots"></i> <b>{{ i18n.ts.menu }}</b> … {{ i18n.ts._initialTutorial._note.menu }}</div>
+	</div>
+</div>
+<div v-else-if="phase === 'howToReact'" class="_gaps">
+	<div style="text-align: center; padding: 0 16px;">{{ i18n.ts._initialTutorial._reaction.description }}</div>
+	<div>{{ i18n.ts._initialTutorial._reaction.letsTryReacting }}</div>
+	<MkNote :class="$style.exampleNoteRoot" :note="exampleNote" :mock="true" @reaction="addReaction" @removeReaction="removeReaction" @updateReaction="updateReaction"/>
+	<div v-if="onceReacted"><b style="color: var(--accent);"><i class="ti ti-check"></i> {{ i18n.ts._initialTutorial.wellDone }}</b> {{ i18n.ts._initialTutorial._reaction.reactNotification }}<br>{{ i18n.ts._initialTutorial._reaction.reactDone }}</div>
+</div>
+</template>
+
+<script setup lang="ts">
+import * as Misskey from 'misskey-js';
+import { ref, reactive } from 'vue';
+import { i18n } from '@/i18n.js';
+import { globalEvents } from '@/events.js';
+import { $i } from '@/account.js';
+import MkNote from '@/components/MkNote.vue';
+
+const props = defineProps<{
+	phase: 'aboutNote' | 'howToReact';
+}>();
+
+const emit = defineEmits<{
+	(ev: 'reacted'): void;
+}>();
+
+const exampleNote = reactive<Misskey.entities.Note>({
+	id: '0000000000',
+	createdAt: '2019-04-14T17:30:49.181Z',
+	userId: '0000000001',
+	user: {
+		id: '0000000001',
+		name: '藍',
+		username: 'ai',
+		host: null,
+		avatarDecorations: [],
+		avatarUrl: '/client-assets/tutorial/ai.webp',
+		avatarBlurhash: 'eiKmhHIByXxZ~qWXs:-pR*NbR*s:xuRjoL-oR*WCt6WWf6WVf6oeWB',
+		isBot: false,
+		isCat: true,
+		emojis: {},
+		onlineStatus: null,
+		badgeRoles: [],
+	},
+	text: 'just setting up my msky',
+	cw: null,
+	visibility: 'public',
+	localOnly: false,
+	reactionAcceptance: null,
+	renoteCount: 0,
+	repliesCount: 1,
+	reactions: {},
+	reactionEmojis: {},
+	fileIds: [],
+	files: [],
+	replyId: null,
+	renoteId: null,
+});
+const onceReacted = ref<boolean>(false);
+
+function addReaction(emoji) {
+	onceReacted.value = true;
+	emit('reacted');
+	exampleNote.reactions[emoji] = 1;
+	exampleNote.myReaction = emoji;
+	doNotification(emoji);
+}
+
+function doNotification(emoji: string): void {
+	if (!$i || !emoji) return;
+
+	const notification: Misskey.entities.Notification = {
+		id: Math.random().toString(),
+		createdAt: new Date().toUTCString(),
+		isRead: false,
+		type: 'reaction',
+		reaction: emoji,
+		user: $i,
+		userId: $i.id,
+		note: exampleNote,
+	};
+
+	globalEvents.emit('clientNotification', notification);
+}
+
+function removeReaction(emoji) {
+	delete exampleNote.reactions[emoji];
+	exampleNote.myReaction = undefined;
+}
+</script>
+
+<style lang="scss" module>
+.exampleNoteRoot {
+	border-radius: var(--radius);
+	border: var(--panelBorder);
+	background: var(--panel);
+}
+
+.divider {
+	height: 1px;
+	background: var(--divider);
+}
+</style>
--- a/packages/frontend/src/components/MkTutorialDialog.PostNote.vue
+++ b/packages/frontend/src/components/MkTutorialDialog.PostNote.vue
@@ -0,0 +1,135 @@
+<!--
+SPDX-FileCopyrightText: syuilo and other misskey contributors
+SPDX-License-Identifier: AGPL-3.0-only
+-->
+
+<template>
+<div class="_gaps">
+	<div style="text-align: center; padding: 0 16px;">{{ i18n.ts._initialTutorial._postNote.description1 }}</div>
+	<MkPostForm :class="$style.exampleRoot" :mock="true" :autofocus="false"/>
+	<MkFormSection>
+		<template #label>{{ i18n.ts.visibility }}</template>
+		<div class="_gaps">
+			<div>{{ i18n.ts._initialTutorial._postNote._visibility.description }}</div>
+			<div><i class="ti ti-world"></i> <b>{{ i18n.ts._visibility.public }}</b> … {{ i18n.ts._initialTutorial._postNote._visibility.public }}</div>
+			<div><i class="ti ti-home"></i> <b>{{ i18n.ts._visibility.home }}</b> … {{ i18n.ts._initialTutorial._postNote._visibility.home }}</div>
+			<div><i class="ti ti-lock"></i> <b>{{ i18n.ts._visibility.followers }}</b> … {{ i18n.ts._initialTutorial._postNote._visibility.followers }}</div>
+			<div class="_gaps_s">
+				<div><i class="ti ti-mail"></i> <b>{{ i18n.ts._visibility.specified }}</b> … {{ i18n.ts._initialTutorial._postNote._visibility.direct }}</div>
+				<MkInfo :warn="true">
+					<b>{{ i18n.ts._initialTutorial._postNote._visibility.doNotSendConfidencialOnDirect1 }}</b> {{ i18n.ts._initialTutorial._postNote._visibility.doNotSendConfidencialOnDirect2 }}
+				</MkInfo>
+			</div>
+			<div><i class="ti ti-rocket-off"></i> <b>{{ i18n.ts._visibility.disableFederation }}</b> … {{ i18n.ts._initialTutorial._postNote._visibility.localOnly }}</div>
+		</div>
+	</MkFormSection>
+	<MkFormSection>
+		<template #label>{{ i18n.ts._initialTutorial._postNote._cw.title }}</template>
+		<div class="_gaps">
+			<div>{{ i18n.ts._initialTutorial._postNote._cw.description }}</div>
+			<MkNote :class="$style.exampleRoot" :note="exampleCWNote" :mock="true"/>
+			<div>{{ i18n.ts._initialTutorial._postNote._cw.useCases }}</div>
+		</div>
+	</MkFormSection>
+</div>
+</template>
+
+<script setup lang="ts">
+import * as Misskey from 'misskey-js';
+import { reactive } from 'vue';
+import { i18n } from '@/i18n.js';
+import MkNote from '@/components/MkNote.vue';
+import MkPostForm from '@/components/MkPostForm.vue';
+import MkFormSection from '@/components/form/section.vue';
+import MkInfo from '@/components/MkInfo.vue';
+
+const exampleCWNote = reactive<Misskey.entities.Note>({
+	id: '0000000000',
+	createdAt: '2019-04-14T17:30:49.181Z',
+	userId: '0000000001',
+	user: {
+		id: '0000000001',
+		name: '藍',
+		username: 'ai',
+		host: null,
+		avatarDecorations: [],
+		avatarUrl: '/client-assets/tutorial/ai.webp',
+		avatarBlurhash: 'eiKmhHIByXxZ~qWXs:-pR*NbR*s:xuRjoL-oR*WCt6WWf6WVf6oeWB',
+		isBot: false,
+		isCat: true,
+		emojis: {},
+		onlineStatus: null,
+		badgeRoles: [],
+	},
+	text: i18n.ts._initialTutorial._postNote._cw._exampleNote.note,
+	cw: i18n.ts._initialTutorial._postNote._cw._exampleNote.cw,
+	visibility: 'public',
+	localOnly: false,
+	reactionAcceptance: null,
+	renoteCount: 0,
+	repliesCount: 1,
+	reactions: {},
+	reactionEmojis: {},
+	fileIds: [],
+	files: [],
+	replyId: null,
+	renoteId: null,
+});
+</script>
+
+<style lang="scss" module>
+.exampleRoot {
+	max-width: none!important;
+	border-radius: var(--radius);
+	border: var(--panelBorder);
+	background: var(--panel);
+}
+
+.divider {
+	height: 1px;
+	background: var(--divider);
+}
+
+.image {
+	max-width: 300px;
+	margin: 0 auto;
+}
+
+.post {
+	position: relative;
+	display: block;
+	width: 100%;
+	height: 40px;
+	color: var(--fgOnAccent);
+	font-weight: bold;
+	text-align: left;
+
+	&:before {
+		content: "";
+		display: block;
+		width: calc(100% - 38px);
+		height: 100%;
+		margin: auto;
+		position: absolute;
+		top: 0;
+		left: 0;
+		right: 0;
+		bottom: 0;
+		border-radius: 999px;
+		background: linear-gradient(90deg, var(--buttonGradateA), var(--buttonGradateB));
+	}
+
+}
+
+.postIcon {
+	position: relative;
+	margin-left: 30px;
+	margin-right: 8px;
+	width: 32px;
+}
+
+.postText {
+	position: relative;
+	line-height: 40px;
+}
+</style>
--- a/packages/frontend/src/components/MkTutorialDialog.Sensitive.vue
+++ b/packages/frontend/src/components/MkTutorialDialog.Sensitive.vue
@@ -0,0 +1,145 @@
+<!--
+SPDX-FileCopyrightText: syuilo and other misskey contributors
+SPDX-License-Identifier: AGPL-3.0-only
+-->
+
+<template>
+<div class="_gaps">
+	<div style="text-align: center; padding: 0 16px;">{{ i18n.ts._initialTutorial._howToMakeAttachmentsSensitive.description }}</div>
+	<div>{{ i18n.ts._initialTutorial._howToMakeAttachmentsSensitive.tryThisFile }}</div>
+	<MkInfo>{{ i18n.ts._initialTutorial._howToMakeAttachmentsSensitive.method }}</MkInfo>
+	<MkPostForm
+		:class="$style.exampleRoot"
+		:mock="true"
+		:autofocus="false"
+		:initialNote="exampleNote"
+		@fileChangeSensitive="doSucceeded"
+	></MkPostForm>
+	<div v-if="onceSucceeded"><b style="color: var(--accent);"><i class="ti ti-check"></i> {{ i18n.ts._initialTutorial.wellDone }}</b> {{ i18n.ts._initialTutorial._howToMakeAttachmentsSensitive.sensitiveSucceeded }}</div>
+	<MkFolder>
+		<template #label>{{ i18n.ts.previewNoteText }}</template>
+		<MkNote :mock="true" :note="exampleNote" :class="$style.exampleRoot"></MkNote>
+	</MkFolder>
+</div>
+</template>
+
+<script setup lang="ts">
+import * as Misskey from 'misskey-js';
+import { ref, reactive } from 'vue';
+import { i18n } from '@/i18n.js';
+import MkPostForm from '@/components/MkPostForm.vue';
+import MkFolder from '@/components/MkFolder.vue';
+import MkInfo from '@/components/MkInfo.vue';
+import MkNote from '@/components/MkNote.vue';
+import { $i } from '@/account.js';
+
+const emit = defineEmits<{
+	(ev: 'succeeded'): void;
+}>();
+
+const onceSucceeded = ref<boolean>(false);
+
+function doSucceeded(fileId: string, to: boolean) {
+	if (fileId === exampleNote.fileIds[0] && to) {
+		onceSucceeded.value = true;
+		emit('succeeded');
+	}
+}
+
+const exampleNote = reactive<Misskey.entities.Note>({
+	id: '0000000000',
+	createdAt: '2019-04-14T17:30:49.181Z',
+	userId: '0000000001',
+	user: $i!,
+	text: i18n.ts._initialTutorial._howToMakeAttachmentsSensitive._exampleNote.note,
+	cw: null,
+	visibility: 'public',
+	localOnly: false,
+	reactionAcceptance: null,
+	renoteCount: 0,
+	repliesCount: 1,
+	reactions: {},
+	reactionEmojis: {},
+	fileIds: ['0000000002'],
+	files: [{
+		id: '0000000002',
+		createdAt: '2019-04-14T17:30:49.181Z',
+		name: 'natto_failed.webp',
+		type: 'image/webp',
+		md5: 'c44286cf152d0740be0ce5ad45ea85c3',
+		size: 827532,
+		isSensitive: false,
+		blurhash: 'LXNA3TD*XAIA%1%M%gt7.TofRioz',
+		properties: {
+			width: 256,
+			height: 256,
+		},
+		url: '/client-assets/tutorial/natto_failed.webp',
+		thumbnailUrl: '/client-assets/tutorial/natto_failed.webp',
+		comment: null,
+		folderId: null,
+		folder: null,
+		userId: null,
+		user: null,
+	}],
+	replyId: null,
+	renoteId: null,
+});
+
+</script>
+
+<style lang="scss" module>
+.exampleRoot {
+	border-radius: var(--radius);
+	border: var(--panelBorder);
+	background: var(--panel);
+}
+
+.divider {
+	height: 1px;
+	background: var(--divider);
+}
+
+.image {
+	max-width: 300px;
+	margin: 0 auto;
+}
+
+.post {
+	position: relative;
+	display: block;
+	width: 100%;
+	height: 40px;
+	color: var(--fgOnAccent);
+	font-weight: bold;
+	text-align: left;
+
+	&:before {
+		content: "";
+		display: block;
+		width: calc(100% - 38px);
+		height: 100%;
+		margin: auto;
+		position: absolute;
+		top: 0;
+		left: 0;
+		right: 0;
+		bottom: 0;
+		border-radius: 999px;
+		background: linear-gradient(90deg, var(--buttonGradateA), var(--buttonGradateB));
+	}
+
+}
+
+.postIcon {
+	position: relative;
+	margin-left: 30px;
+	margin-right: 8px;
+	width: 32px;
+}
+
+.postText {
+	position: relative;
+	line-height: 40px;
+}
+</style>
--- a/packages/frontend/src/components/MkTutorialDialog.Timeline.vue
+++ b/packages/frontend/src/components/MkTutorialDialog.Timeline.vue
@@ -0,0 +1,87 @@
+<!--
+SPDX-FileCopyrightText: syuilo and other misskey contributors
+SPDX-License-Identifier: AGPL-3.0-only
+-->
+
+<template>
+<div class="_gaps">
+	<div style="text-align: center; padding: 0 16px;">{{ i18n.ts._initialTutorial._timeline.description1 }}</div>
+	<div class="_gaps_s">
+		<div><i class="ti ti-home"></i> <b>{{ i18n.ts._timelines.home }}</b> … {{ i18n.ts._initialTutorial._timeline.home }}</div>
+		<div><i class="ti ti-planet"></i> <b>{{ i18n.ts._timelines.local }}</b> … {{ i18n.ts._initialTutorial._timeline.local }}</div>
+		<div><i class="ti ti-universe"></i> <b>{{ i18n.ts._timelines.social }}</b> … {{ i18n.ts._initialTutorial._timeline.social }}</div>
+		<div><i class="ti ti-whirl"></i> <b>{{ i18n.ts._timelines.global }}</b> … {{ i18n.ts._initialTutorial._timeline.global }}</div>
+	</div>
+	<div class="_gaps_s">
+		<div>{{ i18n.ts._initialTutorial._timeline.description2 }}</div>
+		<img :class="$style.image" src="/client-assets/tutorial/timeline_tab.png"/>
+	</div>
+	<div :class="$style.divider"></div>
+	<I18n :src="i18n.ts._initialTutorial._timeline.description3" tag="div" style="padding: 0 16px;">
+		<template #link>
+			<a href="https://misskey-hub.net/docs/features/timeline.html" target="_blank" class="_link">{{ i18n.ts.help }}</a>
+		</template>
+	</I18n>
+
+</div>
+</template>
+
+<script setup lang="ts">
+import { i18n } from '@/i18n.js';
+</script>
+
+<style lang="scss" module>
+.exampleNoteRoot {
+	border-radius: var(--radius);
+	border: var(--panelBorder);
+	background: var(--panel);
+}
+
+.divider {
+	height: 1px;
+	background: var(--divider);
+}
+
+.image {
+	max-width: 300px;
+	margin: 0 auto;
+}
+
+.post {
+	position: relative;
+	display: block;
+	width: 100%;
+	height: 40px;
+	color: var(--fgOnAccent);
+	font-weight: bold;
+	text-align: left;
+
+	&:before {
+		content: "";
+		display: block;
+		width: calc(100% - 38px);
+		height: 100%;
+		margin: auto;
+		position: absolute;
+		top: 0;
+		left: 0;
+		right: 0;
+		bottom: 0;
+		border-radius: 999px;
+		background: linear-gradient(90deg, var(--buttonGradateA), var(--buttonGradateB));
+	}
+
+}
+
+.postIcon {
+	position: relative;
+	margin-left: 30px;
+	margin-right: 8px;
+	width: 32px;
+}
+
+.postText {
+	position: relative;
+	line-height: 40px;
+}
+</style>
--- a/packages/frontend/src/components/MkTutorialDialog.vue
+++ b/packages/frontend/src/components/MkTutorialDialog.vue
@@ -0,0 +1,260 @@
+<!--
+SPDX-FileCopyrightText: syuilo and other misskey contributors
+SPDX-License-Identifier: AGPL-3.0-only
+-->
+
+<template>
+<MkModalWindow
+	ref="dialog"
+	:width="600"
+	:height="650"
+	@close="close(true)"
+	@closed="emit('closed')"
+>
+	<template v-if="page === 1" #header><i class="ti ti-pencil"></i> {{ i18n.ts._initialTutorial._note.title }}</template>
+	<template v-else-if="page === 2" #header><i class="ti ti-mood-smile"></i> {{ i18n.ts._initialTutorial._reaction.title }}</template>
+	<template v-else-if="page === 3" #header><i class="ti ti-home"></i> {{ i18n.ts._initialTutorial._timeline.title }}</template>
+	<template v-else-if="page === 4" #header><i class="ti ti-pencil-plus"></i> {{ i18n.ts._initialTutorial._postNote.title }}</template>
+	<template v-else-if="page === 5" #header><i class="ti ti-eye-exclamation"></i> {{ i18n.ts._initialTutorial._howToMakeAttachmentsSensitive.title }}</template>
+	<template v-else #header>{{ i18n.ts._initialTutorial.title }}</template>
+
+	<div style="overflow-x: clip;">
+		<Transition
+			mode="out-in"
+			:enterActiveClass="$style.transition_x_enterActive"
+			:leaveActiveClass="$style.transition_x_leaveActive"
+			:enterFromClass="$style.transition_x_enterFrom"
+			:leaveToClass="$style.transition_x_leaveTo"
+		>
+			<template v-if="page === 0">
+				<div :class="$style.centerPage">
+					<MkAnimBg style="position: absolute; top: 0;" :scale="1.5"/>
+					<MkSpacer :marginMin="20" :marginMax="28">
+						<div class="_gaps" style="text-align: center;">
+							<i class="ti ti-confetti" style="display: block; margin: auto; font-size: 3em; color: var(--accent);"></i>
+							<div style="font-size: 120%;">{{ i18n.ts._initialTutorial._landing.title }}</div>
+							<div>{{ i18n.ts._initialTutorial._landing.description }}</div>
+							<MkButton primary rounded gradate style="margin: 16px auto 0 auto;" @click="page++">{{ i18n.ts._initialTutorial.launchTutorial }} <i class="ti ti-arrow-right"></i></MkButton>
+							<MkButton style="margin: 0 auto;" transparent rounded @click="close(true)">{{ i18n.ts.close }}</MkButton>
+						</div>
+					</MkSpacer>
+				</div>
+			</template>
+			<template v-else-if="page === 1">
+				<div style="height: 100cqh; overflow: auto;">
+					<div :class="$style.pageRoot">
+						<MkSpacer :marginMin="20" :marginMax="28" :class="$style.pageMain">
+							<XNote phase="aboutNote"/>
+						</MkSpacer>
+						<div :class="$style.pageFooter">
+							<div class="_buttonsCenter">
+								<MkButton v-if="initialPage !== 1" rounded @click="page--"><i class="ti ti-arrow-left"></i> {{ i18n.ts.goBack }}</MkButton>
+								<MkButton primary rounded gradate @click="page++">{{ i18n.ts.continue }} <i class="ti ti-arrow-right"></i></MkButton>
+							</div>
+						</div>
+					</div>
+				</div>
+			</template>
+			<template v-else-if="page === 2">
+				<div style="height: 100cqh; overflow: auto;">
+					<div :class="$style.pageRoot">
+						<MkSpacer :marginMin="20" :marginMax="28" :class="$style.pageMain">
+							<div class="_gaps">
+								<XNote phase="howToReact" @reacted="isReactionTutorialPushed = true"/>
+								<div v-if="!isReactionTutorialPushed">{{ i18n.ts._initialTutorial._reaction.reactToContinue }}</div>
+							</div>
+						</MkSpacer>
+						<div :class="$style.pageFooter">
+							<div class="_buttonsCenter">
+								<MkButton v-if="initialPage !== 2" rounded @click="page--"><i class="ti ti-arrow-left"></i> {{ i18n.ts.goBack }}</MkButton>
+								<MkButton primary rounded gradate :disabled="!isReactionTutorialPushed" @click="page++">{{ i18n.ts.continue }} <i class="ti ti-arrow-right"></i></MkButton>
+							</div>
+						</div>
+					</div>
+				</div>
+			</template>
+			<template v-else-if="page === 3">
+				<div style="height: 100cqh; overflow: auto;">
+					<div :class="$style.pageRoot">
+						<MkSpacer :marginMin="20" :marginMax="28" :class="$style.pageMain">
+							<XTimeline/>
+						</MkSpacer>
+						<div :class="$style.pageFooter">
+							<div class="_buttonsCenter">
+								<MkButton v-if="initialPage !== 3" rounded @click="page--"><i class="ti ti-arrow-left"></i> {{ i18n.ts.goBack }}</MkButton>
+								<MkButton primary rounded gradate @click="page++">{{ i18n.ts.continue }} <i class="ti ti-arrow-right"></i></MkButton>
+							</div>
+						</div>
+					</div>
+				</div>
+			</template>
+			<template v-else-if="page === 4">
+				<div style="height: 100cqh; overflow: auto;">
+					<div :class="$style.pageRoot">
+						<MkSpacer :marginMin="20" :marginMax="28" :class="$style.pageMain">
+							<XPostNote/>
+						</MkSpacer>
+						<div :class="$style.pageFooter">
+							<div class="_buttonsCenter">
+								<MkButton v-if="initialPage !== 3" rounded @click="page--"><i class="ti ti-arrow-left"></i> {{ i18n.ts.goBack }}</MkButton>
+								<MkButton primary rounded gradate @click="page++">{{ i18n.ts.continue }} <i class="ti ti-arrow-right"></i></MkButton>
+							</div>
+						</div>
+					</div>
+				</div>
+			</template>
+			<template v-else-if="page === 5">
+				<div style="height: 100cqh; overflow: auto;">
+					<div :class="$style.pageRoot">
+						<MkSpacer :marginMin="20" :marginMax="28" :class="$style.pageMain">
+							<div class="_gaps">
+								<XSensitive @succeeded="isSensitiveTutorialSucceeded = true"/>
+								<div v-if="!isSensitiveTutorialSucceeded">{{ i18n.ts._initialTutorial._howToMakeAttachmentsSensitive.doItToContinue }}</div>
+							</div>
+						</MkSpacer>
+						<div :class="$style.pageFooter">
+							<div class="_buttonsCenter">
+								<MkButton v-if="initialPage !== 2" rounded @click="page--"><i class="ti ti-arrow-left"></i> {{ i18n.ts.goBack }}</MkButton>
+								<MkButton primary rounded gradate :disabled="!isSensitiveTutorialSucceeded" @click="page++">{{ i18n.ts.continue }} <i class="ti ti-arrow-right"></i></MkButton>
+							</div>
+						</div>
+					</div>
+				</div>
+			</template>
+			<template v-else-if="page === 6">
+				<div :class="$style.centerPage">
+					<MkAnimBg style="position: absolute; top: 0;" :scale="1.5"/>
+					<MkSpacer :marginMin="20" :marginMax="28">
+						<div class="_gaps" style="text-align: center;">
+							<i class="ti ti-check" style="display: block; margin: auto; font-size: 3em; color: var(--accent);"></i>
+							<div style="font-size: 120%;">{{ i18n.ts._initialTutorial._done.title }}</div>
+							<I18n :src="i18n.ts._initialTutorial._done.description" tag="div" style="padding: 0 16px;">
+								<template #link>
+									<a href="https://misskey-hub.net/help.html" target="_blank" class="_link">{{ i18n.ts.help }}</a>
+								</template>
+							</I18n>
+							<div>{{ i18n.t('_initialAccountSetting.haveFun', { name: instance.name ?? host }) }}</div>
+							<div class="_buttonsCenter" style="margin-top: 16px;">
+								<MkButton v-if="initialPage !== 4" rounded @click="page--"><i class="ti ti-arrow-left"></i> {{ i18n.ts.goBack }}</MkButton>
+								<MkButton rounded primary gradate @click="close(false)">{{ i18n.ts.close }}</MkButton>
+							</div>
+						</div>
+					</MkSpacer>
+				</div>
+			</template>
+		</Transition>
+	</div>
+</MkModalWindow>
+</template>
+
+<script lang="ts" setup>
+import { ref, shallowRef, watch } from 'vue';
+import MkModalWindow from '@/components/MkModalWindow.vue';
+import MkButton from '@/components/MkButton.vue';
+import XNote from '@/components/MkTutorialDialog.Note.vue';
+import XTimeline from '@/components/MkTutorialDialog.Timeline.vue';
+import XPostNote from '@/components/MkTutorialDialog.PostNote.vue';
+import XSensitive from '@/components/MkTutorialDialog.Sensitive.vue';
+import MkAnimBg from '@/components/MkAnimBg.vue';
+import { i18n } from '@/i18n.js';
+import { instance } from '@/instance.js';
+import { host } from '@/config.js';
+import { claimAchievement } from '@/scripts/achievements.js';
+import * as os from '@/os.js';
+
+const props = defineProps<{
+	initialPage?: number;
+}>();
+
+const emit = defineEmits<{
+	(ev: 'closed'): void;
+}>();
+
+const dialog = shallowRef<InstanceType<typeof MkModalWindow>>();
+
+// eslint-disable-next-line vue/no-setup-props-destructure
+const page = ref(props.initialPage ?? 0);
+
+watch(page, (to) => {
+	// チュートリアルの枚数を増やしたら必ず変更すること！！
+	if (to === 6) {
+		claimAchievement('tutorialCompleted');
+	}
+});
+
+const isReactionTutorialPushed = ref<boolean>(false);
+const isSensitiveTutorialSucceeded = ref<boolean>(false);
+
+async function close(skip: boolean) {
+	if (skip) {
+		const { canceled } = await os.confirm({
+			type: 'warning',
+			text: i18n.ts._initialTutorial.skipAreYouSure,
+		});
+		if (canceled) return;
+	}
+
+	dialog.value?.close();
+}
+</script>
+
+<style lang="scss" module>
+.transition_x_enterActive,
+.transition_x_leaveActive {
+	transition: opacity 0.3s cubic-bezier(0,0,.35,1), transform 0.3s cubic-bezier(0,0,.35,1);
+}
+.transition_x_enterFrom {
+	opacity: 0;
+	transform: translateX(50px);
+}
+.transition_x_leaveTo {
+	opacity: 0;
+	transform: translateX(-50px);
+}
+
+.progressBar {
+	position: absolute;
+	top: 0;
+	left: 0;
+	z-index: 10;
+	width: 100%;
+	height: 4px;
+}
+
+.progressBarValue {
+	height: 100%;
+	background: linear-gradient(90deg, var(--buttonGradateA), var(--buttonGradateB));
+	transition: all 0.5s cubic-bezier(0,.5,.5,1);
+}
+
+.centerPage {
+	display: flex;
+	justify-content: center;
+	align-items: center;
+	height: 100cqh;
+	padding-bottom: 30px;
+	box-sizing: border-box;
+}
+
+.pageRoot {
+	display: flex;
+	flex-direction: column;
+	min-height: 100%;
+}
+
+.pageMain {
+	flex-grow: 1;
+	line-height: 1.5;
+}
+
+.pageFooter {
+	position: sticky;
+	bottom: 0;
+	left: 0;
+	flex-shrink: 0;
+	padding: 12px;
+	border-top: solid 0.5px var(--divider);
+	-webkit-backdrop-filter: blur(15px);
+	backdrop-filter: blur(15px);
+}
+</style>
--- a/packages/frontend/src/components/MkUserInfo.vue
+++ b/packages/frontend/src/components/MkUserInfo.vue
@@ -14,7 +14,7 @@ SPDX-License-Identifier: AGPL-3.0-only
 	<span v-if="$i && $i.id !== user.id && user.isFollowed" :class="$style.followed">{{ i18n.ts.followsYou }}</span>
 	<div :class="$style.description">
 		<div v-if="user.description" :class="$style.mfm">
-			<Mfm :text="user.description" :author="user" :i="$i"/>
+			<Mfm :text="user.description" :author="user"/>
 		</div>
 		<span v-else style="opacity: 0.7;">{{ i18n.ts.noAccountDescription }}</span>
 	</div>
--- a/packages/frontend/src/components/MkUserPopup.vue
+++ b/packages/frontend/src/components/MkUserPopup.vue
@@ -27,7 +27,7 @@ SPDX-License-Identifier: AGPL-3.0-only
 				<div :class="$style.username"><MkAcct :user="user"/></div>
 			</div>
 			<div :class="$style.description">
-				<Mfm v-if="user.description" :class="$style.mfm" :text="user.description" :author="user" :i="$i"/>
+				<Mfm v-if="user.description" :class="$style.mfm" :text="user.description" :author="user"/>
 				<div v-else style="opacity: 0.7;">{{ i18n.ts.noAccountDescription }}</div>
 			</div>
 			<div :class="$style.status">
--- a/packages/frontend/src/components/MkUserSetupDialog.User.vue
+++ b/packages/frontend/src/components/MkUserSetupDialog.User.vue
@@ -13,7 +13,7 @@ SPDX-License-Identifier: AGPL-3.0-only
 	</div>
 	<div :class="$style.description">
 		<div v-if="user.description" :class="$style.mfm">
-			<Mfm :text="user.description" :author="user" :i="$i"/>
+			<Mfm :text="user.description" :author="user"/>
 		</div>
 		<span v-else style="opacity: 0.7;">{{ i18n.ts.noAccountDescription }}</span>
 	</div>
--- a/packages/frontend/src/components/MkUserSetupDialog.vue
+++ b/packages/frontend/src/components/MkUserSetupDialog.vue
@@ -46,24 +46,32 @@ SPDX-License-Identifier: AGPL-3.0-only
 			</template>
 			<template v-else-if="page === 1">
 				<div style="height: 100cqh; overflow: auto;">
-					<MkSpacer :marginMin="20" :marginMax="28">
-						<XProfile/>
-						<div class="_buttonsCenter" style="margin-top: 16px;">
-							<MkButton rounded data-cy-user-setup-back @click="page--"><i class="ti ti-arrow-left"></i> {{ i18n.ts.goBack }}</MkButton>
-							<MkButton primary rounded gradate data-cy-user-setup-continue @click="page++">{{ i18n.ts.continue }} <i class="ti ti-arrow-right"></i></MkButton>
+					<div :class="$style.pageRoot">
+						<MkSpacer :marginMin="20" :marginMax="28" :class="$style.pageMain">
+							<XProfile/>
+						</MkSpacer>
+						<div :class="$style.pageFooter">
+							<div class="_buttonsCenter">
+								<MkButton rounded data-cy-user-setup-back @click="page--"><i class="ti ti-arrow-left"></i> {{ i18n.ts.goBack }}</MkButton>
+								<MkButton primary rounded gradate data-cy-user-setup-continue @click="page++">{{ i18n.ts.continue }} <i class="ti ti-arrow-right"></i></MkButton>
+							</div>
 						</div>
-					</MkSpacer>
+					</div>
 				</div>
 			</template>
 			<template v-else-if="page === 2">
 				<div style="height: 100cqh; overflow: auto;">
-					<MkSpacer :marginMin="20" :marginMax="28">
-						<XPrivacy/>
-						<div class="_buttonsCenter" style="margin-top: 16px;">
-							<MkButton rounded data-cy-user-setup-back @click="page--"><i class="ti ti-arrow-left"></i> {{ i18n.ts.goBack }}</MkButton>
-							<MkButton primary rounded gradate data-cy-user-setup-continue @click="page++">{{ i18n.ts.continue }} <i class="ti ti-arrow-right"></i></MkButton>
+					<div :class="$style.pageRoot">
+						<MkSpacer :marginMin="20" :marginMax="28" :class="$style.pageMain">
+							<XPrivacy/>
+						</MkSpacer>
+						<div :class="$style.pageFooter">
+							<div class="_buttonsCenter">
+								<MkButton rounded data-cy-user-setup-back @click="page--"><i class="ti ti-arrow-left"></i> {{ i18n.ts.goBack }}</MkButton>
+								<MkButton primary rounded gradate data-cy-user-setup-continue @click="page++">{{ i18n.ts.continue }} <i class="ti ti-arrow-right"></i></MkButton>
+							</div>
 						</div>
-					</MkSpacer>
+					</div>
 				</div>
 			</template>
 			<template v-else-if="page === 3">
@@ -102,16 +110,13 @@ SPDX-License-Identifier: AGPL-3.0-only
 						<div class="_gaps" style="text-align: center;">
 							<i class="ti ti-check" style="display: block; margin: auto; font-size: 3em; color: var(--accent);"></i>
 							<div style="font-size: 120%;">{{ i18n.ts._initialAccountSetting.initialAccountSettingCompleted }}</div>
-							<I18n :src="i18n.ts._initialAccountSetting.ifYouNeedLearnMore" tag="div" style="padding: 0 16px;">
-								<template #name>{{ instance.name ?? host }}</template>
-								<template #link>
-									<a href="https://misskey-hub.net/help.html" target="_blank" class="_link">{{ i18n.ts.help }}</a>
-								</template>
-							</I18n>
-							<div>{{ i18n.t('_initialAccountSetting.haveFun', { name: instance.name ?? host }) }}</div>
+							<div>{{ i18n.t('_initialAccountSetting.youCanContinueTutorial', { name: instance.name ?? host }) }}</div>
 							<div class="_buttonsCenter" style="margin-top: 16px;">
+								<MkButton rounded primary gradate data-cy-user-setup-continue @click="launchTutorial()">{{ i18n.ts._initialAccountSetting.startTutorial }} <i class="ti ti-arrow-right"></i></MkButton>
+							</div>
+							<div class="_buttonsCenter">
 								<MkButton rounded data-cy-user-setup-back @click="page--"><i class="ti ti-arrow-left"></i> {{ i18n.ts.goBack }}</MkButton>
-								<MkButton primary rounded gradate data-cy-user-setup-continue @click="close(false)">{{ i18n.ts.close }}</MkButton>
+								<MkButton rounded primary data-cy-user-setup-continue @click="setupComplete()">{{ i18n.ts.close }}</MkButton>
 							</div>
 						</div>
 					</MkSpacer>
@@ -123,7 +128,7 @@ SPDX-License-Identifier: AGPL-3.0-only
 </template>

 <script lang="ts" setup>
-import { ref, shallowRef, watch } from 'vue';
+import { ref, shallowRef, watch, nextTick, defineAsyncComponent } from 'vue';
 import MkModalWindow from '@/components/MkModalWindow.vue';
 import MkButton from '@/components/MkButton.vue';
 import XProfile from '@/components/MkUserSetupDialog.Profile.vue';
@@ -143,6 +148,7 @@ const emit = defineEmits<{

 const dialog = shallowRef<InstanceType<typeof MkModalWindow>>();

+// eslint-disable-next-line vue/no-setup-props-destructure
 const page = ref(defaultStore.state.accountSetupWizard);

 watch(page, () => {
@@ -158,10 +164,24 @@ async function close(skip: boolean) {
 		if (canceled) return;
 	}

-	dialog.value.close();
+	dialog.value?.close();
 	defaultStore.set('accountSetupWizard', -1);
 }

+function setupComplete() {
+	defaultStore.set('accountSetupWizard', -1);
+	dialog.value?.close();
+}
+
+function launchTutorial() {
+	setupComplete();
+	nextTick(() => {
+		os.popup(defineAsyncComponent(() => import('@/components/MkTutorialDialog.vue')), {
+			initialPage: 1,
+		}, {}, 'closed');
+	});
+}
+
 async function later(later: boolean) {
 	if (later) {
 		const { canceled } = await os.confirm({
@@ -171,7 +191,7 @@ async function later(later: boolean) {
 		if (canceled) return;
 	}

-	dialog.value.close();
+	dialog.value?.close();
 	defaultStore.set('accountSetupWizard', 0);
 }
 </script>
@@ -214,10 +234,21 @@ async function later(later: boolean) {
 	box-sizing: border-box;
 }

+.pageRoot {
+	display: flex;
+	flex-direction: column;
+	min-height: 100%;
+}
+
+.pageMain {
+	flex-grow: 1;
+}
+
 .pageFooter {
 	position: sticky;
 	bottom: 0;
 	left: 0;
+	flex-shrink: 0;
 	padding: 12px;
 	border-top: solid 0.5px var(--divider);
 	-webkit-backdrop-filter: blur(15px);
--- a/packages/frontend/src/components/MkVisibilityPicker.vue
+++ b/packages/frontend/src/components/MkVisibilityPicker.vue
@@ -9,7 +9,7 @@ SPDX-License-Identifier: AGPL-3.0-only
 		<div :class="[$style.label, $style.item]">
 			{{ i18n.ts.visibility }}
 		</div>
-		<button key="public" class="_button" :class="[$style.item, { [$style.active]: v === 'public' }]" data-index="1" @click="choose('public')">
+		<button key="public" :disabled="isSilenced" class="_button" :class="[$style.item, { [$style.active]: v === 'public' }]" data-index="1" @click="choose('public')">
 			<div :class="$style.icon"><i class="ti ti-world"></i></div>
 			<div :class="$style.body">
 				<span :class="$style.itemTitle">{{ i18n.ts._visibility.public }}</span>
@@ -51,6 +51,7 @@ const modal = $shallowRef<InstanceType<typeof MkModal>>();

 const props = withDefaults(defineProps<{
 	currentVisibility: typeof Misskey.noteVisibilities[number];
+	isSilenced: boolean;
 	localOnly: boolean;
 	src?: HTMLElement;
 }>(), {
--- a/packages/frontend/src/components/global/MkAcct.vue
+++ b/packages/frontend/src/components/global/MkAcct.vue
@@ -17,7 +17,6 @@ SPDX-License-Identifier: AGPL-3.0-only
 <script lang="ts" setup>
 import * as Misskey from 'misskey-js';
 import { toUnicode } from 'punycode/';
-import MkCondensedLine from './MkCondensedLine.vue';
 import { host as hostRaw } from '@/config.js';
 import { defaultStore } from '@/store.js';

--- a/packages/frontend/src/components/global/MkAvatar.vue
+++ b/packages/frontend/src/components/global/MkAvatar.vue
@@ -5,7 +5,7 @@ SPDX-License-Identifier: AGPL-3.0-only

 <template>
 <component :is="link ? MkA : 'span'" v-user-preview="preview ? user.id : undefined" v-bind="bound" class="_noSelect" :class="[$style.root, { [$style.animation]: animation, [$style.cat]: user.isCat, [$style.square]: squareAvatars }]" :style="{ color }" :title="acct(user)" @click="onClick">
-	<MkImgWithBlurhash :class="$style.inner" :src="url" :hash="user?.avatarBlurhash" :cover="true" :onlyAvgColor="true"/>
+	<MkImgWithBlurhash :class="$style.inner" :src="url" :hash="user.avatarBlurhash" :cover="true" :onlyAvgColor="true"/>
 	<MkUserOnlineIndicator v-if="indicator" :class="$style.indicator" :user="user"/>
 	<div v-if="user.isCat" :class="[$style.ears]">
 		<div :class="$style.earLeft">
@@ -23,6 +23,16 @@ SPDX-License-Identifier: AGPL-3.0-only
 			</div>
 		</div>
 	</div>
+	<img
+		v-if="showDecoration && (decoration || user.avatarDecorations.length > 0)"
+		:class="[$style.decoration]"
+		:src="decoration?.url ?? user.avatarDecorations[0].url"
+		:style="{
+			rotate: getDecorationAngle(),
+			scale: getDecorationScale(),
+		}"
+		alt=""
+	>
 </component>
 </template>

@@ -47,22 +57,33 @@ const props = withDefaults(defineProps<{
 	link?: boolean;
 	preview?: boolean;
 	indicator?: boolean;
+	decoration?: {
+		url: string;
+		angle?: number;
+		flipH?: boolean;
+		flipV?: boolean;
+	};
+	forceShowDecoration?: boolean;
 }>(), {
 	target: null,
 	link: false,
 	preview: false,
 	indicator: false,
+	decoration: undefined,
+	forceShowDecoration: false,
 });

 const emit = defineEmits<{
 	(ev: 'click', v: MouseEvent): void;
 }>();

+const showDecoration = props.forceShowDecoration || defaultStore.state.showAvatarDecorations;
+
 const bound = $computed(() => props.link
 	? { to: userPage(props.user), target: props.target }
 	: {});

-const url = $computed(() => defaultStore.state.disableShowingAnimatedImages
+const url = $computed(() => (defaultStore.state.disableShowingAnimatedImages || defaultStore.state.enableDataSaverMode)
 	? getStaticImageUrl(props.user.avatarUrl)
 	: props.user.avatarUrl);

@@ -71,6 +92,30 @@ function onClick(ev: MouseEvent): void {
 	emit('click', ev);
 }

+function getDecorationAngle() {
+	let angle;
+	if (props.decoration) {
+		angle = props.decoration.angle ?? 0;
+	} else if (props.user.avatarDecorations.length > 0) {
+		angle = props.user.avatarDecorations[0].angle ?? 0;
+	} else {
+		angle = 0;
+	}
+	return angle === 0 ? undefined : `${angle * 360}deg`;
+}
+
+function getDecorationScale() {
+	let scaleX;
+	if (props.decoration) {
+		scaleX = props.decoration.flipH ? -1 : 1;
+	} else if (props.user.avatarDecorations.length > 0) {
+		scaleX = props.user.avatarDecorations[0].flipH ? -1 : 1;
+	} else {
+		scaleX = 1;
+	}
+	return scaleX === 1 ? undefined : `${scaleX} 1`;
+}
+
 let color = $ref<string | undefined>();

 watch(() => props.user.avatarBlurhash, () => {
@@ -134,7 +179,7 @@ watch(() => props.user.avatarBlurhash, () => {

 .indicator {
 	position: absolute;
-	z-index: 1;
+	z-index: 2;
 	bottom: 0;
 	left: 0;
 	width: 20%;
@@ -278,4 +323,13 @@ watch(() => props.user.avatarBlurhash, () => {
 		}
 	}
 }
+
+.decoration {
+	position: absolute;
+	z-index: 1;
+	top: -50%;
+	left: -50%;
+	width: 200%;
+	pointer-events: none;
+}
 </style>
--- a/packages/frontend/src/components/global/MkCondensedLine.vue
+++ b/packages/frontend/src/components/global/MkCondensedLine.vue
@@ -18,10 +18,10 @@ interface Props {

 const contentSymbol = Symbol();
 const observer = new ResizeObserver((entries) => {
-  const results: {
-    container: HTMLSpanElement;
-    transform: string;
-  }[] = [];
+	const results: {
+		container: HTMLSpanElement;
+		transform: string;
+	}[] = [];
 	for (const entry of entries) {
 		const content = (entry.target[contentSymbol] ? entry.target : entry.target.firstElementChild) as HTMLSpanElement;
 		const props: Required<Props> = content[contentSymbol];
--- a/packages/frontend/src/components/global/MkCustomEmoji.vue
+++ b/packages/frontend/src/components/global/MkCustomEmoji.vue
@@ -5,14 +5,27 @@ SPDX-License-Identifier: AGPL-3.0-only

 <template>
 <span v-if="errored">:{{ customEmojiName }}:</span>
-<img v-else :class="[$style.root, { [$style.normal]: normal, [$style.noStyle]: noStyle }]" :src="url" :alt="alt" :title="alt" decoding="async" @error="errored = true" @load="errored = false"/>
+<img
+	v-else
+	:class="[$style.root, { [$style.normal]: normal, [$style.noStyle]: noStyle }]"
+	:src="url"
+	:alt="alt"
+	:title="alt"
+	decoding="async"
+	@error="errored = true"
+	@load="errored = false"
+	@click="onClick"
+/>
 </template>

 <script lang="ts" setup>
-import { computed } from 'vue';
+import { computed, inject } from 'vue';
 import { getProxiedImageUrl, getStaticImageUrl } from '@/scripts/media-proxy.js';
 import { defaultStore } from '@/store.js';
 import { customEmojisMap } from '@/custom-emojis.js';
+import * as os from '@/os.js';
+import copyToClipboard from '@/scripts/copy-to-clipboard.js';
+import { i18n } from '@/i18n.js';

 const props = defineProps<{
 	name: string;
@@ -21,8 +34,12 @@ const props = defineProps<{
 	host?: string | null;
 	url?: string;
 	useOriginalSize?: boolean;
+	menu?: boolean;
+	menuReaction?: boolean;
 }>();

+const react = inject<((name: string) => void) | null>('react', null);
+
 const customEmojiName = computed(() => (props.name[0] === ':' ? props.name.substring(1, props.name.length - 1) : props.name).replace('@.', ''));
 const isLocal = computed(() => !props.host && (customEmojiName.value.endsWith('@.') || !customEmojiName.value.includes('@')));

@@ -55,6 +72,28 @@ const url = computed(() => {

 const alt = computed(() => `:${customEmojiName.value}:`);
 let errored = $ref(url.value == null);
+
+function onClick(ev: MouseEvent) {
+	if (props.menu) {
+		os.popupMenu([{
+			type: 'label',
+			text: `:${props.name}:`,
+		}, {
+			text: i18n.ts.copy,
+			icon: 'ti ti-copy',
+			action: () => {
+				copyToClipboard(`:${props.name}:`);
+				os.success();
+			},
+		}, ...(props.menuReaction && react ? [{
+			text: i18n.ts.doReaction,
+			icon: 'ti ti-plus',
+			action: () => {
+				react(`:${props.name}:`);
+			},
+		}] : [])], ev.currentTarget ?? ev.target);
+	}
+}
 </script>

 <style lang="scss" module>
--- a/packages/frontend/src/components/global/MkEmoji.vue
+++ b/packages/frontend/src/components/global/MkEmoji.vue
@@ -4,21 +4,28 @@ SPDX-License-Identifier: AGPL-3.0-only
 -->

 <template>
-<img v-if="!useOsNativeEmojis" :class="$style.root" :src="url" :alt="props.emoji" decoding="async" @pointerenter="computeTitle"/>
-<span v-else-if="useOsNativeEmojis" :alt="props.emoji" @pointerenter="computeTitle">{{ props.emoji }}</span>
+<img v-if="!useOsNativeEmojis" :class="$style.root" :src="url" :alt="props.emoji" decoding="async" @pointerenter="computeTitle" @click="onClick"/>
+<span v-else-if="useOsNativeEmojis" :alt="props.emoji" @pointerenter="computeTitle" @click="onClick">{{ props.emoji }}</span>
 <span v-else>{{ emoji }}</span>
 </template>

 <script lang="ts" setup>
-import { computed } from 'vue';
+import { computed, inject } from 'vue';
 import { char2twemojiFilePath, char2fluentEmojiFilePath } from '@/scripts/emoji-base.js';
 import { defaultStore } from '@/store.js';
 import { getEmojiName } from '@/scripts/emojilist.js';
+import * as os from '@/os.js';
+import copyToClipboard from '@/scripts/copy-to-clipboard.js';
+import { i18n } from '@/i18n.js';

 const props = defineProps<{
 	emoji: string;
+	menu?: boolean;
+	menuReaction?: boolean;
 }>();

+const react = inject<((name: string) => void) | null>('react', null);
+
 const char2path = defaultStore.state.emojiStyle === 'twemoji' ? char2twemojiFilePath : char2fluentEmojiFilePath;

 const useOsNativeEmojis = computed(() => defaultStore.state.emojiStyle === 'native');
@@ -31,6 +38,28 @@ function computeTitle(event: PointerEvent): void {
 	const title = getEmojiName(props.emoji as string) ?? props.emoji as string;
 	(event.target as HTMLElement).title = title;
 }
+
+function onClick(ev: MouseEvent) {
+	if (props.menu) {
+		os.popupMenu([{
+			type: 'label',
+			text: props.emoji,
+		}, {
+			text: i18n.ts.copy,
+			icon: 'ti ti-copy',
+			action: () => {
+				copyToClipboard(props.emoji);
+				os.success();
+			},
+		}, ...(props.menuReaction && react ? [{
+			text: i18n.ts.doReaction,
+			icon: 'ti ti-plus',
+			action: () => {
+				react(props.emoji);
+			},
+		}] : [])], ev.currentTarget ?? ev.target);
+	}
+}
 </script>

 <style lang="scss" module>
--- a/packages/frontend/src/components/global/MkFooterSpacer.vue
+++ b/packages/frontend/src/components/global/MkFooterSpacer.vue
@@ -0,0 +1,32 @@
+<!--
+SPDX-FileCopyrightText: syuilo and other misskey contributors
+SPDX-License-Identifier: AGPL-3.0-only
+-->
+
+<template>
+<div :class="[$style.spacer, defaultStore.reactiveState.darkMode.value ? $style.dark : $style.light]"></div>
+</template>
+
+<script lang="ts" setup>
+import { defaultStore } from '@/store.js';
+</script>
+
+<style lang="scss" module>
+.spacer {
+	box-sizing: border-box;
+	padding: 32px;
+	margin: 0 auto;
+	height: 300px;
+	background-clip: content-box;
+	background-size: auto auto;
+	background-color: rgba(255, 255, 255, 0);
+
+	&.light {
+		background-image: repeating-linear-gradient(135deg, transparent, transparent 16px, #00000010 16px, #00000010 20px );
+	}
+
+	&.dark {
+		background-image: repeating-linear-gradient(135deg, transparent, transparent 16px, #FFFFFF16 16px, #FFFFFF16 20px );
+	}
+}
+</style>
--- a/packages/frontend/src/components/global/MkMisskeyFlavoredMarkdown.ts
+++ b/packages/frontend/src/components/global/MkMisskeyFlavoredMarkdown.ts
@@ -17,7 +17,7 @@ import MkSparkle from '@/components/MkSparkle.vue';
 import MkA from '@/components/global/MkA.vue';
 import { host } from '@/config.js';
 import { defaultStore } from '@/store.js';
-import { nyaize } from '@/scripts/nyaize.js';
+import { nyaize as doNyaize } from '@/scripts/nyaize.js';

 const QUOTE_STYLE = `
 display: block;
@@ -28,21 +28,29 @@ border-left: solid 3px var(--fg);
 opacity: 0.7;
 `.split('\n').join(' ');

-export default function(props: {
+type MfmProps = {
 	text: string;
 	plain?: boolean;
 	nowrap?: boolean;
 	author?: Misskey.entities.UserLite;
-	i?: Misskey.entities.UserLite;
 	isNote?: boolean;
 	emojiUrls?: string[];
 	rootScale?: number;
-}) {
-	const isNote = props.isNote !== undefined ? props.isNote : true;
+	nyaize: boolean | 'account';
+	parsedNodes?: mfm.MfmNode[] | null;
+	enableEmojiMenu?: boolean;
+	enableEmojiMenuReaction?: boolean;
+};

+// eslint-disable-next-line import/no-default-export
+export default function(props: MfmProps) {
+	const isNote = props.isNote ?? true;
+	const shouldNyaize = props.nyaize ? props.nyaize === 'account' ? props.author?.isCat : false : false;
+
+	// eslint-disable-next-line @typescript-eslint/no-unnecessary-condition
 	if (props.text == null || props.text === '') return;

-	const ast = (props.plain ? mfm.parseSimple : mfm.parse)(props.text);
+	const rootAst = props.parsedNodes ?? (props.plain ? mfm.parseSimple : mfm.parse)(props.text);

 	const validTime = (t: string | null | undefined) => {
 		if (t == null) return null;
@@ -55,13 +63,14 @@ export default function(props: {
 	 * Gen Vue Elements from MFM AST
 	 * @param ast MFM AST
 	 * @param scale How times large the text is
+	 * @param disableNyaize Whether nyaize is disabled or not
 	 */
 	const genEl = (ast: mfm.MfmNode[], scale: number, disableNyaize = false) => ast.map((token): VNode | string | (VNode | string)[] => {
 		switch (token.type) {
 			case 'text': {
 				let text = token.props.text.replace(/(\r\n|\n|\r)/g, '\n');
-				if (!disableNyaize && props.author?.isCat) {
-					text = nyaize(text);
+				if (!disableNyaize && shouldNyaize) {
+					text = doNyaize(text);
 				}

 				if (!props.plain) {
@@ -320,6 +329,8 @@ export default function(props: {
 						normal: props.plain,
 						host: null,
 						useOriginalSize: scale >= 2.5,
+						menu: props.enableEmojiMenu,
+						menuReaction: props.enableEmojiMenuReaction,
 					})];
 				} else {
 					// eslint-disable-next-line @typescript-eslint/no-unnecessary-condition
@@ -343,6 +354,8 @@ export default function(props: {
 				return [h(MkEmoji, {
 					key: Math.random(),
 					emoji: token.props.emoji,
+					menu: props.enableEmojiMenu,
+					menuReaction: props.enableEmojiMenuReaction,
 				})];
 			}

@@ -377,5 +390,5 @@ export default function(props: {
 	return h('span', {
 		// https://codeday.me/jp/qa/20190424/690106.html
 		style: props.nowrap ? 'white-space: pre; word-wrap: normal; overflow: hidden; text-overflow: ellipsis;' : 'white-space: pre-wrap;',
-	}, genEl(ast, props.rootScale ?? 1));
+	}, genEl(rootAst, props.rootScale ?? 1));
 }
--- a/packages/frontend/src/components/global/MkPageHeader.tabs.vue
+++ b/packages/frontend/src/components/global/MkPageHeader.tabs.vue
@@ -134,9 +134,11 @@ async function enter(el: HTMLElement) {

 	setTimeout(renderTab, 170);
 }
+
 function afterEnter(el: HTMLElement) {
 	//el.style.width = '';
 }
+
 async function leave(el: HTMLElement) {
 	const elementWidth = el.getBoundingClientRect().width;
 	el.style.width = elementWidth + 'px';
@@ -145,6 +147,7 @@ async function leave(el: HTMLElement) {
 	el.style.width = '0';
 	el.style.paddingLeft = '0';
 }
+
 function afterLeave(el: HTMLElement) {
 	el.style.width = '';
 }
--- a/packages/frontend/src/components/global/MkUrl.vue
+++ b/packages/frontend/src/components/global/MkUrl.vue
@@ -31,23 +31,28 @@ import * as os from '@/os.js';
 import { useTooltip } from '@/scripts/use-tooltip.js';
 import { safeURIDecode } from '@/scripts/safe-uri-decode.js';

-const props = defineProps<{
+const props = withDefaults(defineProps<{
 	url: string;
 	rel?: string;
-}>();
+	showUrlPreview?: boolean;
+}>(), {
+	showUrlPreview: true,
+});

 const self = props.url.startsWith(local);
 const url = new URL(props.url);
 if (!['http:', 'https:'].includes(url.protocol)) throw new Error('invalid url');
 const el = ref();

-useTooltip(el, (showing) => {
-	os.popup(defineAsyncComponent(() => import('@/components/MkUrlPreviewPopup.vue')), {
-		showing,
-		url: props.url,
-		source: el.value,
-	}, {}, 'closed');
-});
+if (props.showUrlPreview) {
+	useTooltip(el, (showing) => {
+		os.popup(defineAsyncComponent(() => import('@/components/MkUrlPreviewPopup.vue')), {
+			showing,
+			url: props.url,
+			source: el.value,
+		}, {}, 'closed');
+	});
+}

 const schema = url.protocol;
 const hostname = decodePunycode(url.hostname);
--- a/packages/frontend/src/components/index.ts
+++ b/packages/frontend/src/components/index.ts
@@ -5,7 +5,7 @@

 import { App } from 'vue';

-import Mfm from './global/MkMisskeyFlavoredMarkdown.ts';
+import Mfm from './global/MkMisskeyFlavoredMarkdown.js';
 import MkA from './global/MkA.vue';
 import MkAcct from './global/MkAcct.vue';
 import MkAvatar from './global/MkAvatar.vue';
@@ -16,13 +16,14 @@ import MkUserName from './global/MkUserName.vue';
 import MkEllipsis from './global/MkEllipsis.vue';
 import MkTime from './global/MkTime.vue';
 import MkUrl from './global/MkUrl.vue';
-import I18n from './global/i18n';
+import I18n from './global/i18n.js';
 import RouterView from './global/RouterView.vue';
 import MkLoading from './global/MkLoading.vue';
 import MkError from './global/MkError.vue';
 import MkAd from './global/MkAd.vue';
 import MkPageHeader from './global/MkPageHeader.vue';
 import MkSpacer from './global/MkSpacer.vue';
+import MkFooterSpacer from './global/MkFooterSpacer.vue';
 import MkStickyContainer from './global/MkStickyContainer.vue';

 export default function(app: App) {
@@ -50,6 +51,7 @@ export const components = {
 	MkAd: MkAd,
 	MkPageHeader: MkPageHeader,
 	MkSpacer: MkSpacer,
+	MkFooterSpacer: MkFooterSpacer,
 	MkStickyContainer: MkStickyContainer,
 };

@@ -73,6 +75,7 @@ declare module '@vue/runtime-core' {
 		MkAd: typeof MkAd;
 		MkPageHeader: typeof MkPageHeader;
 		MkSpacer: typeof MkSpacer;
+		MkFooterSpacer: typeof MkFooterSpacer;
 		MkStickyContainer: typeof MkStickyContainer;
 	}
 }
--- a/packages/frontend/src/components/page/page.text.vue
+++ b/packages/frontend/src/components/page/page.text.vue
@@ -5,7 +5,7 @@ SPDX-License-Identifier: AGPL-3.0-only

 <template>
 <div class="_gaps">
-	<Mfm :text="block.text" :isNote="false" :i="$i"/>
+	<Mfm :text="block.text" :isNote="false"/>
 	<MkUrlPreview v-for="url in urls" :key="url" :url="url"/>
 </div>
 </template>